| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[DIR]](/icons/folder.gif) | jzmq/ | 2025-05-28 12:54 | - | |
| ![[DIR]](/icons/folder.gif) | jzlib/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | jzip/ | 2025-09-09 06:23 | - | |
| ![[DIR]](/icons/folder.gif) | jython/ | 2023-01-09 20:31 | - | |
| ![[DIR]](/icons/folder.gif) | jxrlib/ | 2024-08-20 16:32 | - | |
| ![[DIR]](/icons/folder.gif) | jxplorer/ | 2023-11-22 01:32 | - | |
| ![[DIR]](/icons/folder.gif) | jxgrabkey/ | 2024-04-22 18:51 | - | |
| ![[DIR]](/icons/folder.gif) | jws-api/ | 2021-01-28 14:17 | - | |
| ![[DIR]](/icons/folder.gif) | jwm/ | 2025-02-10 20:52 | - | |
| ![[DIR]](/icons/folder.gif) | jwhois/ | 2016-11-01 09:14 | - | |
| ![[DIR]](/icons/folder.gif) | jwchat/ | 2021-01-07 08:26 | - | |
| ![[DIR]](/icons/folder.gif) | jvyamlb/ | 2021-01-02 14:13 | - | |
| ![[DIR]](/icons/folder.gif) | jvim/ | 2020-07-14 22:44 | - | |
| ![[DIR]](/icons/folder.gif) | jverein/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jutils/ | 2020-06-08 01:18 | - | |
| ![[DIR]](/icons/folder.gif) | justbuild/ | 2025-05-24 08:57 | - | |
| ![[DIR]](/icons/folder.gif) | justbackoff/ | 2024-11-01 16:06 | - | |
| ![[DIR]](/icons/folder.gif) | jupytext/ | 2024-12-09 02:50 | - | |
| ![[DIR]](/icons/folder.gif) | jupyterlab/ | 2025-06-07 15:12 | - | |
| ![[DIR]](/icons/folder.gif) | jupyterlab-server/ | 2024-01-26 07:55 | - | |
| ![[DIR]](/icons/folder.gif) | jupyterlab-pygments/ | 2024-01-11 03:14 | - | |
| ![[DIR]](/icons/folder.gif) | jupyterhub/ | 2025-05-31 08:52 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-ydoc/ | 2024-09-06 08:15 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-telemetry/ | 2024-01-13 09:09 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-sphinx/ | 2025-10-28 07:50 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-sphinx-theme/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-server/ | 2025-05-06 01:08 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-server-terminals/ | 2025-05-12 14:43 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-server-mathjax/ | 2024-08-09 15:08 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-packaging/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-notebook/ | 2025-04-28 08:24 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-kernel-test/ | 2025-05-05 14:43 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-events/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-core/ | 2024-12-18 03:05 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-console/ | 2025-01-04 08:05 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-comm/ | 2024-01-31 13:40 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-client/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jupyter-cache/ | 2025-05-11 14:11 | - | |
| ![[DIR]](/icons/folder.gif) | jupp/ | 2025-08-28 15:44 | - | |
| ![[DIR]](/icons/folder.gif) | junos-eznc/ | 2025-02-17 08:52 | - | |
| ![[DIR]](/icons/folder.gif) | junixsocket/ | 2024-05-29 19:24 | - | |
| ![[DIR]](/icons/folder.gif) | junitperf/ | 2016-04-08 08:50 | - | |
| ![[DIR]](/icons/folder.gif) | junitparser/ | 2025-10-28 20:34 | - | |
| ![[DIR]](/icons/folder.gif) | junit5/ | 2024-07-15 07:50 | - | |
| ![[DIR]](/icons/folder.gif) | junit5-system-exit/ | 2024-01-11 15:31 | - | |
| ![[DIR]](/icons/folder.gif) | junit4/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | junit/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | junior-doc/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jumpnbump/ | 2024-11-01 20:36 | - | |
| ![[DIR]](/icons/folder.gif) | jumpnbump-levels/ | 2019-11-18 13:13 | - | |
| ![[DIR]](/icons/folder.gif) | jumbo/ | 2022-11-07 06:50 | - | |
| ![[DIR]](/icons/folder.gif) | juman/ | 2025-09-23 03:24 | - | |
| ![[DIR]](/icons/folder.gif) | julius-voxforge/ | 2013-06-10 18:03 | - | |
| ![[DIR]](/icons/folder.gif) | julia/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | julia-factcheck/ | 2014-09-15 20:27 | - | |
| ![[DIR]](/icons/folder.gif) | juke/ | 2018-06-22 23:13 | - | |
| ![[DIR]](/icons/folder.gif) | juk/ | 2025-10-21 03:21 | - | |
| ![[DIR]](/icons/folder.gif) | juju/ | 2015-04-27 23:59 | - | |
| ![[DIR]](/icons/folder.gif) | juju-quickstart/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | juju-mongodb3.2/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | juju-mongodb2.6/ | 2016-08-11 02:46 | - | |
| ![[DIR]](/icons/folder.gif) | juju-mongodb/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | juju-mongo-tools3.2/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | juju-jitsu/ | 2015-04-27 23:59 | - | |
| ![[DIR]](/icons/folder.gif) | juju-deployer/ | 2020-03-05 20:16 | - | |
| ![[DIR]](/icons/folder.gif) | juju-core/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | juju-core-1/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | jugglinglab/ | 2021-01-10 01:51 | - | |
| ![[DIR]](/icons/folder.gif) | jugglemaster/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | jug/ | 2025-02-02 07:58 | - | |
| ![[DIR]](/icons/folder.gif) | juffed/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | judy/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | juce/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | jube/ | 2025-05-02 06:47 | - | |
| ![[DIR]](/icons/folder.gif) | jts/ | 2024-11-25 20:54 | - | |
| ![[DIR]](/icons/folder.gif) | jtreg8/ | 2025-10-29 07:00 | - | |
| ![[DIR]](/icons/folder.gif) | jtreg7/ | 2025-10-17 03:09 | - | |
| ![[DIR]](/icons/folder.gif) | jtreg6/ | 2024-01-26 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jtreg/ | 2021-12-18 14:16 | - | |
| ![[DIR]](/icons/folder.gif) | jtidy/ | 2025-02-02 07:58 | - | |
| ![[DIR]](/icons/folder.gif) | jthread/ | 2021-01-06 14:19 | - | |
| ![[DIR]](/icons/folder.gif) | jtharness/ | 2024-01-11 03:14 | - | |
| ![[DIR]](/icons/folder.gif) | jtex-base/ | 2024-07-19 07:46 | - | |
| ![[DIR]](/icons/folder.gif) | jtdx/ | 2025-03-23 11:28 | - | |
| ![[DIR]](/icons/folder.gif) | jtb/ | 2023-02-05 08:54 | - | |
| ![[DIR]](/icons/folder.gif) | jta/ | 2016-11-01 09:15 | - | |
| ![[DIR]](/icons/folder.gif) | jsymphonic/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jsxgraph/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jsusfx/ | 2024-11-01 20:36 | - | |
| ![[DIR]](/icons/folder.gif) | jsurf-alggeo/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jsunit/ | 2021-06-25 02:14 | - | |
| ![[DIR]](/icons/folder.gif) | jstyleson/ | 2022-11-13 20:31 | - | |
| ![[DIR]](/icons/folder.gif) | jstimezonedetect.js/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jstest-gtk/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | jst-config/ | 2025-01-31 00:08 | - | |
| ![[DIR]](/icons/folder.gif) | jssip/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | jssc/ | 2024-04-24 02:54 | - | |
| ![[DIR]](/icons/folder.gif) | jss/ | 2024-04-05 09:26 | - | |
| ![[DIR]](/icons/folder.gif) | jsrender/ | 2022-11-22 01:40 | - | |
| ![[DIR]](/icons/folder.gif) | jsr107cache/ | 2016-11-01 09:11 | - | |
| ![[DIR]](/icons/folder.gif) | jsquery/ | 2025-10-28 07:51 | - | |
| ![[DIR]](/icons/folder.gif) | jspwiki/ | 2016-11-01 09:15 | - | |
| ![[DIR]](/icons/folder.gif) | jsp-api/ | 2020-04-28 05:13 | - | |
| ![[DIR]](/icons/folder.gif) | jsoup/ | 2024-01-11 15:31 | - | |
| ![[DIR]](/icons/folder.gif) | jsonrpclib-pelix/ | 2022-07-23 16:03 | - | |
| ![[DIR]](/icons/folder.gif) | jsonrpc-glib/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jsonpipe/ | 2020-03-31 08:24 | - | |
| ![[DIR]](/icons/folder.gif) | jsonpickle/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jsonpath-ng/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jsonnet/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | jsonm/ | 2025-07-04 09:21 | - | |
| ![[DIR]](/icons/folder.gif) | jsonlint/ | 2025-02-16 04:25 | - | |
| ![[DIR]](/icons/folder.gif) | jsonld-java/ | 2024-02-26 21:52 | - | |
| ![[DIR]](/icons/folder.gif) | jsonhyperschema-codec/ | 2022-05-30 02:18 | - | |
| ![[DIR]](/icons/folder.gif) | jsoncons/ | 2025-10-28 14:07 | - | |
| ![[DIR]](/icons/folder.gif) | jsonbot/ | 2015-06-16 13:34 | - | |
| ![[DIR]](/icons/folder.gif) | jsonb-api/ | 2021-01-28 14:17 | - | |
| ![[DIR]](/icons/folder.gif) | json11/ | 2021-10-21 19:14 | - | |
| ![[DIR]](/icons/folder.gif) | json4s/ | 2018-11-25 08:28 | - | |
| ![[DIR]](/icons/folder.gif) | json2file-go/ | 2025-06-27 15:37 | - | |
| ![[DIR]](/icons/folder.gif) | json-wheel/ | 2016-11-01 16:12 | - | |
| ![[DIR]](/icons/folder.gif) | json-tricks/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | json-test-data/ | 2025-09-30 20:05 | - | |
| ![[DIR]](/icons/folder.gif) | json-static/ | 2016-11-01 16:12 | - | |
| ![[DIR]](/icons/folder.gif) | json-spirit/ | 2016-04-16 02:42 | - | |
| ![[DIR]](/icons/folder.gif) | json-smart/ | 2025-07-05 00:03 | - | |
| ![[DIR]](/icons/folder.gif) | json-simple/ | 2025-02-17 02:32 | - | |
| ![[DIR]](/icons/folder.gif) | json-schema-validator/ | 2020-07-14 22:44 | - | |
| ![[DIR]](/icons/folder.gif) | json-schema-test-suite/ | 2020-06-20 14:13 | - | |
| ![[DIR]](/icons/folder.gif) | json-js/ | 2023-01-01 01:44 | - | |
| ![[DIR]](/icons/folder.gif) | json-glib/ | 2025-10-02 15:33 | - | |
| ![[DIR]](/icons/folder.gif) | json-editor.js/ | 2025-10-20 04:13 | - | |
| ![[DIR]](/icons/folder.gif) | jsofa/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jsmpp/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jsmn/ | 2022-07-23 16:03 | - | |
| ![[DIR]](/icons/folder.gif) | jsmath/ | 2023-02-23 01:19 | - | |
| ![[DIR]](/icons/folder.gif) | jsmath-fonts/ | 2023-07-27 03:42 | - | |
| ![[DIR]](/icons/folder.gif) | jsmath-fonts-sprite/ | 2023-06-13 08:16 | - | |
| ![[DIR]](/icons/folder.gif) | jskeus/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jsjac/ | 2021-02-07 21:42 | - | |
| ![[DIR]](/icons/folder.gif) | jsilver/ | 2012-07-01 16:03 | - | |
| ![[DIR]](/icons/folder.gif) | jshon/ | 2025-05-03 19:00 | - | |
| ![[DIR]](/icons/folder.gif) | jshash/ | 2024-12-05 07:55 | - | |
| ![[DIR]](/icons/folder.gif) | jsemver/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jsdoc-toolkit/ | 2021-01-06 07:55 | - | |
| ![[DIR]](/icons/folder.gif) | jsdebugger/ | 2020-12-28 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jscropperui/ | 2023-08-15 01:45 | - | |
| ![[DIR]](/icons/folder.gif) | jscribble/ | 2016-04-05 10:08 | - | |
| ![[DIR]](/icons/folder.gif) | jscoverage/ | 2016-11-01 09:15 | - | |
| ![[DIR]](/icons/folder.gif) | jscommunicator/ | 2019-01-23 08:31 | - | |
| ![[DIR]](/icons/folder.gif) | jschema-to-python/ | 2023-08-15 01:45 | - | |
| ![[DIR]](/icons/folder.gif) | jsch/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jsch-agent-proxy/ | 2021-01-28 14:17 | - | |
| ![[DIR]](/icons/folder.gif) | jsbundle-web-interfaces/ | 2023-08-15 01:45 | - | |
| ![[DIR]](/icons/folder.gif) | jsap/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jsamp/ | 2024-08-09 09:37 | - | |
| ![[DIR]](/icons/folder.gif) | js8call/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | js2-mode/ | 2025-01-15 02:52 | - | |
| ![[DIR]](/icons/folder.gif) | js-of-ocaml/ | 2025-10-23 21:25 | - | |
| ![[DIR]](/icons/folder.gif) | js-of-ocaml-ocamlbuild/ | 2025-06-19 08:49 | - | |
| ![[DIR]](/icons/folder.gif) | js-build-tools/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | jruby/ | 2025-05-23 20:34 | - | |
| ![[DIR]](/icons/folder.gif) | jruby-utils-clojure/ | 2024-11-22 13:57 | - | |
| ![[DIR]](/icons/folder.gif) | jruby-openssl/ | 2022-12-13 20:34 | - | |
| ![[DIR]](/icons/folder.gif) | jruby-mavengem/ | 2024-02-25 20:44 | - | |
| ![[DIR]](/icons/folder.gif) | jruby-maven-plugins/ | 2025-10-29 23:06 | - | |
| ![[DIR]](/icons/folder.gif) | jruby-joni/ | 2024-01-11 09:10 | - | |
| ![[DIR]](/icons/folder.gif) | jreen/ | 2025-02-20 15:19 | - | |
| ![[DIR]](/icons/folder.gif) | jqueryui/ | 2023-10-05 18:28 | - | |
| ![[DIR]](/icons/folder.gif) | jquery.sparkline/ | 2025-10-28 13:46 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-watermark/ | 2022-11-23 13:34 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-ui-touch-punch.js/ | 2021-11-07 02:15 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-ui-themes/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-typeahead.js/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-timer.js/ | 2017-12-31 13:56 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-timepicker/ | 2023-08-16 08:29 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-throttle-debounce/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-tablesorter/ | 2024-07-29 02:05 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-sortablejs/ | 2024-11-24 14:28 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-slugify.js/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-simpletreemenu/ | 2021-01-08 07:53 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-reflection/ | 2022-11-22 01:40 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-mobile/ | 2022-12-07 14:24 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-minicolors/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-migrate-1/ | 2021-01-04 01:31 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-lazyload/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-jplayer/ | 2016-11-03 21:09 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-jplayer-pinkflag/ | 2016-11-03 21:09 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-jplayer-circleplayer/ | 2014-10-26 09:59 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-jplayer-bluemonday/ | 2016-11-03 21:09 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-i18n.js/ | 2021-01-09 01:40 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-i18n-properties/ | 2022-11-21 13:49 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-goodies/ | 2022-12-03 01:45 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-geo/ | 2022-11-06 12:03 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-datetimepicker/ | 2024-11-24 14:28 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-coolfieldset/ | 2022-11-21 13:49 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-colorbox/ | 2021-01-04 01:30 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-caret.js/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-at.js/ | 2022-05-17 19:50 | - | |
| ![[DIR]](/icons/folder.gif) | jquery-areyousure/ | 2022-05-26 15:39 | - | |
| ![[DIR]](/icons/folder.gif) | jqp/ | 2025-06-27 15:37 | - | |
| ![[DIR]](/icons/folder.gif) | jqapi/ | 2021-01-08 02:15 | - | |
| ![[DIR]](/icons/folder.gif) | jq/ | 2024-11-27 19:23 | - | |
| ![[DIR]](/icons/folder.gif) | jpylyzer/ | 2025-02-12 15:17 | - | |
| ![[DIR]](/icons/folder.gif) | jpy/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jpoker/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jpnevulator/ | 2020-11-02 08:22 | - | |
| ![[DIR]](/icons/folder.gif) | jplephem/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jplayer/ | 2010-12-18 01:26 | - | |
| ![[DIR]](/icons/folder.gif) | jpilot/ | 2017-06-10 01:34 | - | |
| ![[DIR]](/icons/folder.gif) | jpegqs/ | 2022-08-19 02:14 | - | |
| ![[DIR]](/icons/folder.gif) | jpegpixi/ | 2022-04-30 22:41 | - | |
| ![[DIR]](/icons/folder.gif) | jpegoptim/ | 2022-06-21 21:04 | - | |
| ![[DIR]](/icons/folder.gif) | jpegjudge/ | 2024-05-19 07:53 | - | |
| ![[DIR]](/icons/folder.gif) | jpeginfo/ | 2024-04-05 03:15 | - | |
| ![[DIR]](/icons/folder.gif) | jpeg-xl/ | 2025-10-09 03:05 | - | |
| ![[DIR]](/icons/folder.gif) | jpeg-compressor-cpp/ | 2023-07-26 20:32 | - | |
| ![[DIR]](/icons/folder.gif) | jpathwatch/ | 2024-04-22 18:51 | - | |
| ![[DIR]](/icons/folder.gif) | jp2a/ | 2025-08-12 01:54 | - | |
| ![[DIR]](/icons/folder.gif) | jp/ | 2025-06-27 15:37 | - | |
| ![[DIR]](/icons/folder.gif) | joystick/ | 2024-04-13 14:50 | - | |
| ![[DIR]](/icons/folder.gif) | joypy/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | joyent-mdata-client/ | 2024-07-19 06:44 | - | |
| ![[DIR]](/icons/folder.gif) | joy2key/ | 2022-04-30 22:41 | - | |
| ![[DIR]](/icons/folder.gif) | jovie/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jove/ | 2025-09-14 09:06 | - | |
| ![[DIR]](/icons/folder.gif) | journal-brief/ | 2022-07-23 08:19 | - | |
| ![[DIR]](/icons/folder.gif) | josql/ | 2022-05-16 20:20 | - | |
| ![[DIR]](/icons/folder.gif) | josm/ | 2025-10-28 13:46 | - | |
| ![[DIR]](/icons/folder.gif) | josm-plugins/ | 2018-06-22 23:13 | - | |
| ![[DIR]](/icons/folder.gif) | joserfc/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jose/ | 2025-08-18 21:14 | - | |
| ![[DIR]](/icons/folder.gif) | joptsimple/ | 2024-11-03 08:46 | - | |
| ![[DIR]](/icons/folder.gif) | jool/ | 2025-05-26 21:18 | - | |
| ![[DIR]](/icons/folder.gif) | jome/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jolokia/ | 2022-07-12 10:29 | - | |
| ![[DIR]](/icons/folder.gif) | jollyday/ | 2023-01-07 13:59 | - | |
| ![[DIR]](/icons/folder.gif) | joe/ | 2025-01-01 03:17 | - | |
| ![[DIR]](/icons/folder.gif) | jodreports/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | jodd/ | 2021-01-10 01:51 | - | |
| ![[DIR]](/icons/folder.gif) | jodconverter/ | 2023-12-26 13:47 | - | |
| ![[DIR]](/icons/folder.gif) | jodconverter-cli/ | 2023-12-26 13:47 | - | |
| ![[DIR]](/icons/folder.gif) | joda-convert/ | 2023-01-16 13:24 | - | |
| ![[DIR]](/icons/folder.gif) | jobservice/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | jobs-admin/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | joblib/ | 2025-10-28 07:51 | - | |
| ![[DIR]](/icons/folder.gif) | jo/ | 2025-05-09 21:56 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-x86asm/ | 2025-01-24 01:53 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-unixsocket/ | 2025-05-05 14:43 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-posix/ | 2023-12-02 07:31 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-netdb/ | 2025-02-02 02:18 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-ffi/ | 2024-01-14 03:07 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-enxio/ | 2023-12-01 13:35 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-constants/ | 2023-12-02 01:52 | - | |
| ![[DIR]](/icons/folder.gif) | jnr-a64asm/ | 2024-05-03 11:30 | - | |
| ![[DIR]](/icons/folder.gif) | jnoisemeter/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jnoise/ | 2023-10-28 21:56 | - | |
| ![[DIR]](/icons/folder.gif) | jnlp-servlet/ | 2023-05-02 09:52 | - | |
| ![[DIR]](/icons/folder.gif) | jni-inchi/ | 2024-11-14 09:24 | - | |
| ![[DIR]](/icons/folder.gif) | jnettop/ | 2025-02-26 03:14 | - | |
| ![[DIR]](/icons/folder.gif) | jnacl/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jna-inchi/ | 2025-02-20 15:19 | - | |
| ![[DIR]](/icons/folder.gif) | jmxetric/ | 2014-03-11 18:43 | - | |
| ![[DIR]](/icons/folder.gif) | jmtpfs/ | 2024-04-05 03:15 | - | |
| ![[DIR]](/icons/folder.gif) | jmol/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jmodeltest/ | 2022-11-06 12:03 | - | |
| ![[DIR]](/icons/folder.gif) | jmock2/ | 2021-01-19 13:29 | - | |
| ![[DIR]](/icons/folder.gif) | jmock/ | 2025-02-02 02:18 | - | |
| ![[DIR]](/icons/folder.gif) | jmh/ | 2025-10-29 02:13 | - | |
| ![[DIR]](/icons/folder.gif) | jmeters/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jmespath.php/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jmdns/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jmapviewer/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jmagick/ | 2024-11-06 02:49 | - | |
| ![[DIR]](/icons/folder.gif) | jlint/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jline3/ | 2024-07-14 20:49 | - | |
| ![[DIR]](/icons/folder.gif) | jline2/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jline/ | 2020-12-14 19:39 | - | |
| ![[DIR]](/icons/folder.gif) | jlibeps/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jlha-utils/ | 2025-10-28 13:46 | - | |
| ![[DIR]](/icons/folder.gif) | jlex/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jless/ | 2016-11-01 09:15 | - | |
| ![[DIR]](/icons/folder.gif) | jkmeter/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jitterentropy-rngd/ | 2024-05-25 08:26 | - | |
| ![[DIR]](/icons/folder.gif) | jitterentropy-library/ | 2025-10-29 15:28 | - | |
| ![[DIR]](/icons/folder.gif) | jitterdebugger/ | 2024-02-17 02:27 | - | |
| ![[DIR]](/icons/folder.gif) | jitsi/ | 2017-06-16 08:17 | - | |
| ![[DIR]](/icons/folder.gif) | jitescript/ | 2023-11-29 13:35 | - | |
| ![[DIR]](/icons/folder.gif) | jirc/ | 2015-04-30 21:20 | - | |
| ![[DIR]](/icons/folder.gif) | jinput/ | 2024-04-22 18:51 | - | |
| ![[DIR]](/icons/folder.gif) | jinjax/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jinja2/ | 2025-07-04 20:46 | - | |
| ![[DIR]](/icons/folder.gif) | jinja2-time/ | 2024-12-26 15:11 | - | |
| ![[DIR]](/icons/folder.gif) | jinja2-mode/ | 2024-07-26 02:14 | - | |
| ![[DIR]](/icons/folder.gif) | jinja-vanish/ | 2023-08-17 07:46 | - | |
| ![[DIR]](/icons/folder.gif) | jing-trang/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jimtcl/ | 2024-11-01 20:36 | - | |
| ![[DIR]](/icons/folder.gif) | jimfs/ | 2020-08-09 07:18 | - | |
| ![[DIR]](/icons/folder.gif) | jikespg/ | 2020-04-03 02:09 | - | |
| ![[DIR]](/icons/folder.gif) | jigzo/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | jigsaw-generator/ | 2021-02-11 02:16 | - | |
| ![[DIR]](/icons/folder.gif) | jigl/ | 2024-08-04 19:34 | - | |
| ![[DIR]](/icons/folder.gif) | jigit/ | 2024-04-23 08:49 | - | |
| ![[DIR]](/icons/folder.gif) | jigdo/ | 2025-10-28 20:48 | - | |
| ![[DIR]](/icons/folder.gif) | jifty/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jid/ | 2025-06-27 15:37 | - | |
| ![[DIR]](/icons/folder.gif) | jiconfont/ | 2021-02-25 20:18 | - | |
| ![[DIR]](/icons/folder.gif) | jiconfont-swing/ | 2021-02-25 20:18 | - | |
| ![[DIR]](/icons/folder.gif) | jiconfont-font-awesome/ | 2022-08-10 01:23 | - | |
| ![[DIR]](/icons/folder.gif) | jhighlight/ | 2025-02-06 02:52 | - | |
| ![[DIR]](/icons/folder.gif) | jheatchart/ | 2025-02-04 14:32 | - | |
| ![[DIR]](/icons/folder.gif) | jheaps/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jhead/ | 2024-11-10 14:49 | - | |
| ![[DIR]](/icons/folder.gif) | jhdf/ | 2022-07-23 16:03 | - | |
| ![[DIR]](/icons/folder.gif) | jhbuild/ | 2025-04-02 16:13 | - | |
| ![[DIR]](/icons/folder.gif) | jh7100-bootloader-recovery/ | 2023-10-30 19:00 | - | |
| ![[DIR]](/icons/folder.gif) | jh71xx-tools/ | 2024-01-11 03:14 | - | |
| ![[DIR]](/icons/folder.gif) | jgrowl/ | 2021-01-08 02:15 | - | |
| ![[DIR]](/icons/folder.gif) | jgromacs/ | 2025-01-15 08:23 | - | |
| ![[DIR]](/icons/folder.gif) | jgrep/ | 2021-02-04 14:14 | - | |
| ![[DIR]](/icons/folder.gif) | jgrapht/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jgraph/ | 2024-11-17 07:11 | - | |
| ![[DIR]](/icons/folder.gif) | jgmenu/ | 2025-05-26 17:32 | - | |
| ![[DIR]](/icons/folder.gif) | jglobus/ | 2024-11-22 21:04 | - | |
| ![[DIR]](/icons/folder.gif) | jgit/ | 2024-07-20 08:42 | - | |
| ![[DIR]](/icons/folder.gif) | jfugue/ | 2021-01-02 07:42 | - | |
| ![[DIR]](/icons/folder.gif) | jftp/ | 2021-12-23 19:23 | - | |
| ![[DIR]](/icons/folder.gif) | jfreesvg/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jfreepdf/ | 2025-03-08 21:01 | - | |
| ![[DIR]](/icons/folder.gif) | jfree-demos/ | 2025-05-03 18:53 | - | |
| ![[DIR]](/icons/folder.gif) | jfractionlab/ | 2023-11-25 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jformatstring/ | 2025-02-01 08:57 | - | |
| ![[DIR]](/icons/folder.gif) | jflex/ | 2023-05-02 09:52 | - | |
| ![[DIR]](/icons/folder.gif) | jffnms/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jffi/ | 2024-02-21 20:51 | - | |
| ![[DIR]](/icons/folder.gif) | jexcelapi/ | 2025-02-01 08:57 | - | |
| ![[DIR]](/icons/folder.gif) | jeuclid/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jetty12/ | 2025-10-29 09:17 | - | |
| ![[DIR]](/icons/folder.gif) | jetty9/ | 2025-10-28 08:10 | - | |
| ![[DIR]](/icons/folder.gif) | jetty8/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | jetty/ | 2019-02-01 08:30 | - | |
| ![[DIR]](/icons/folder.gif) | jets3t/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jetring/ | 2024-12-15 01:55 | - | |
| ![[DIR]](/icons/folder.gif) | jester/ | 2025-10-06 05:48 | - | |
| ![[DIR]](/icons/folder.gif) | jesred/ | 2025-08-15 22:59 | - | |
| ![[DIR]](/icons/folder.gif) | jesd/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jersey1/ | 2023-01-01 07:29 | - | |
| ![[DIR]](/icons/folder.gif) | jerry/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | jeromq/ | 2025-02-15 08:52 | - | |
| ![[DIR]](/icons/folder.gif) | jericho-html/ | 2025-01-31 22:25 | - | |
| ![[DIR]](/icons/folder.gif) | jerasure/ | 2019-05-22 01:44 | - | |
| ![[DIR]](/icons/folder.gif) | jep/ | 2019-12-13 02:35 | - | |
| ![[DIR]](/icons/folder.gif) | jeolib-miallib/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jeolib-jiplib/ | 2025-10-29 19:15 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-xstream/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-winstone/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-trilead-ssh2/ | 2021-01-29 02:23 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-test-annotations/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-task-reactor/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-remoting/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-memory-monitor/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-json/ | 2024-12-15 14:17 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-job-builder/ | 2025-10-28 20:34 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-htmlunit/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-htmlunit-core-js/ | 2011-12-09 02:20 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-executable-war/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-dom4j/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-debian-glue/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-crypto-util/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-constant-pool-scanner/ | 2014-01-10 09:43 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-commons-jexl/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | jenkins-commons-jelly/ | 2015-04-26 20:11 | - | |
| ![[DIR]](/icons/folder.gif) | jengelman-shadow/ | 2023-01-28 01:40 | - | |
| ![[DIR]](/icons/folder.gif) | jemalloc/ | 2025-02-21 01:00 | - | |
| ![[DIR]](/icons/folder.gif) | jellyfish1/ | 2024-12-23 20:17 | - | |
| ![[DIR]](/icons/folder.gif) | jellyfish/ | 2025-10-19 05:32 | - | |
| ![[DIR]](/icons/folder.gif) | jellyfin-apiclient-python/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jellydoc/ | 2018-01-19 17:26 | - | |
| ![[DIR]](/icons/folder.gif) | jello/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jel/ | 2022-04-30 14:50 | - | |
| ![[DIR]](/icons/folder.gif) | jekyll/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jekyll-theme-minima/ | 2020-04-28 08:26 | - | |
| ![[DIR]](/icons/folder.gif) | jeex/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jeepyb/ | 2022-05-27 08:56 | - | |
| ![[DIR]](/icons/folder.gif) | jeepney/ | 2025-05-02 09:53 | - | |
| ![[DIR]](/icons/folder.gif) | jedit/ | 2021-01-01 07:35 | - | |
| ![[DIR]](/icons/folder.gif) | jed/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jed-extra/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jebl2/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | jdupes/ | 2025-10-29 15:27 | - | |
| ![[DIR]](/icons/folder.gif) | jdresolve/ | 2022-04-30 14:50 | - | |
| ![[DIR]](/icons/folder.gif) | jdim/ | 2024-04-07 20:50 | - | |
| ![[DIR]](/icons/folder.gif) | jdependency/ | 2024-05-03 13:21 | - | |
| ![[DIR]](/icons/folder.gif) | jdelay/ | 2020-04-04 22:53 | - | |
| ![[DIR]](/icons/folder.gif) | jdeb/ | 2024-11-19 02:16 | - | |
| ![[DIR]](/icons/folder.gif) | jdcal/ | 2025-03-23 10:10 | - | |
| ![[DIR]](/icons/folder.gif) | jd/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jctools/ | 2025-02-10 20:52 | - | |
| ![[DIR]](/icons/folder.gif) | jcsp/ | 2023-12-04 01:56 | - | |
| ![[DIR]](/icons/folder.gif) | jconvolver/ | 2024-04-20 08:50 | - | |
| ![[DIR]](/icons/folder.gif) | jcommander/ | 2022-12-22 13:54 | - | |
| ![[DIR]](/icons/folder.gif) | jcodings/ | 2024-01-11 09:10 | - | |
| ![[DIR]](/icons/folder.gif) | jcm/ | 2025-01-31 10:01 | - | |
| ![[DIR]](/icons/folder.gif) | jclicmoodle/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jclic/ | 2021-01-06 01:41 | - | |
| ![[DIR]](/icons/folder.gif) | jclassinfo/ | 2024-11-01 17:53 | - | |
| ![[DIR]](/icons/folder.gif) | jcifs/ | 2025-01-31 10:01 | - | |
| ![[DIR]](/icons/folder.gif) | jcharts/ | 2025-02-01 03:06 | - | |
| ![[DIR]](/icons/folder.gif) | jcdf/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jcc/ | 2024-01-13 15:21 | - | |
| ![[DIR]](/icons/folder.gif) | jcal/ | 2025-05-03 19:01 | - | |
| ![[DIR]](/icons/folder.gif) | jcabi-log/ | 2020-12-27 20:17 | - | |
| ![[DIR]](/icons/folder.gif) | jcabi-aspects/ | 2021-05-09 07:48 | - | |
| ![[DIR]](/icons/folder.gif) | jc/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jbuilder/ | 2018-06-14 08:14 | - | |
| ![[DIR]](/icons/folder.gif) | jbossas4/ | 2016-11-01 21:24 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-xnio/ | 2024-01-11 15:31 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-vfs/ | 2023-06-13 08:16 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-threads/ | 2022-11-06 12:03 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-modules/ | 2025-02-10 08:31 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-logmanager/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-logging/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-logging-tools/ | 2024-12-16 21:16 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-jdeparser2/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-classfilewriter/ | 2025-01-04 14:06 | - | |
| ![[DIR]](/icons/folder.gif) | jboss-bridger/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jbofihe/ | 2016-11-01 16:15 | - | |
| ![[DIR]](/icons/folder.gif) | jblas/ | 2023-10-28 21:56 | - | |
| ![[DIR]](/icons/folder.gif) | jbigkit/ | 2025-10-02 15:33 | - | |
| ![[DIR]](/icons/folder.gif) | jbig2enc/ | 2024-12-30 14:46 | - | |
| ![[DIR]](/icons/folder.gif) | jbig2dec/ | 2025-10-02 15:33 | - | |
| ![[DIR]](/icons/folder.gif) | jbbp/ | 2021-01-11 08:19 | - | |
| ![[DIR]](/icons/folder.gif) | jazip/ | 2020-04-03 11:53 | - | |
| ![[DIR]](/icons/folder.gif) | jayway-jsonpath/ | 2018-09-19 21:58 | - | |
| ![[DIR]](/icons/folder.gif) | jaydebeapi/ | 2025-10-29 02:14 | - | |
| ![[DIR]](/icons/folder.gif) | jayatana/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jaxws/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jaxws-api/ | 2020-12-29 13:35 | - | |
| ![[DIR]](/icons/folder.gif) | jaxrs-api/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jaxrpc-api/ | 2020-07-13 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jaxml/ | 2020-04-01 02:34 | - | |
| ![[DIR]](/icons/folder.gif) | jaxe/ | 2022-12-05 07:30 | - | |
| ![[DIR]](/icons/folder.gif) | jaxb2-maven-plugin/ | 2019-12-29 10:13 | - | |
| ![[DIR]](/icons/folder.gif) | jaxb/ | 2024-11-06 17:34 | - | |
| ![[DIR]](/icons/folder.gif) | jaxb-api/ | 2020-07-13 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jax-maven-plugin/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jawn/ | 2018-11-25 08:28 | - | |
| ![[DIR]](/icons/folder.gif) | javawriter/ | 2021-01-01 07:35 | - | |
| ![[DIR]](/icons/folder.gif) | javatuples/ | 2021-01-01 07:35 | - | |
| ![[DIR]](/icons/folder.gif) | javatools/ | 2025-09-05 03:19 | - | |
| ![[DIR]](/icons/folder.gif) | javassist/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | javaproperties/ | 2024-12-06 03:40 | - | |
| ![[DIR]](/icons/folder.gif) | javapoet/ | 2020-07-08 14:15 | - | |
| ![[DIR]](/icons/folder.gif) | javaparser/ | 2024-08-12 14:59 | - | |
| ![[DIR]](/icons/folder.gif) | javamorph/ | 2023-12-20 19:52 | - | |
| ![[DIR]](/icons/folder.gif) | javamail/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | javahelp2/ | 2022-05-23 13:24 | - | |
| ![[DIR]](/icons/folder.gif) | javafxsvg/ | 2025-01-31 10:01 | - | |
| ![[DIR]](/icons/folder.gif) | javacc5/ | 2022-05-20 08:19 | - | |
| ![[DIR]](/icons/folder.gif) | javacc4/ | 2022-05-17 03:09 | - | |
| ![[DIR]](/icons/folder.gif) | javacc/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | javacc-maven-plugin/ | 2025-04-04 09:12 | - | |
| ![[DIR]](/icons/folder.gif) | javabeans-activation-framework/ | 2018-10-06 11:38 | - | |
| ![[DIR]](/icons/folder.gif) | java3ds-fileloader/ | 2019-10-26 06:16 | - | |
| ![[DIR]](/icons/folder.gif) | java3d/ | 2024-04-05 21:13 | - | |
| ![[DIR]](/icons/folder.gif) | java2html/ | 2021-09-18 20:00 | - | |
| ![[DIR]](/icons/folder.gif) | java-xmlbuilder/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | java-wrappers/ | 2024-08-06 13:30 | - | |
| ![[DIR]](/icons/folder.gif) | java-websocket/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | java-string-similarity/ | 2020-07-07 19:23 | - | |
| ![[DIR]](/icons/folder.gif) | java-sip-api/ | 2021-01-02 07:42 | - | |
| ![[DIR]](/icons/folder.gif) | java-sdp-api/ | 2025-01-31 10:01 | - | |
| ![[DIR]](/icons/folder.gif) | java-policy/ | 2020-07-28 01:34 | - | |
| ![[DIR]](/icons/folder.gif) | java-jmx-clojure/ | 2025-02-20 15:47 | - | |
| ![[DIR]](/icons/folder.gif) | java-imaging-utilities/ | 2023-10-27 06:13 | - | |
| ![[DIR]](/icons/folder.gif) | java-gnome/ | 2024-04-07 02:46 | - | |
| ![[DIR]](/icons/folder.gif) | java-diff-utils/ | 2021-02-06 02:17 | - | |
| ![[DIR]](/icons/folder.gif) | java-data-clojure/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | java-common/ | 2025-10-02 15:33 | - | |
| ![[DIR]](/icons/folder.gif) | java-comment-preprocessor/ | 2025-01-31 10:01 | - | |
| ![[DIR]](/icons/folder.gif) | java-classpath-clojure/ | 2020-12-15 07:50 | - | |
| ![[DIR]](/icons/folder.gif) | java-atk-wrapper/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | java-allocation-instrumenter/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jaula/ | 2024-07-02 14:57 | - | |
| ![[DIR]](/icons/folder.gif) | jattach/ | 2024-01-17 01:55 | - | |
| ![[DIR]](/icons/folder.gif) | jatl/ | 2025-01-30 14:50 | - | |
| ![[DIR]](/icons/folder.gif) | jasypt/ | 2020-10-29 06:29 | - | |
| ![[DIR]](/icons/folder.gif) | jasperreports/ | 2020-07-14 22:44 | - | |
| ![[DIR]](/icons/folder.gif) | jasper/ | 2021-01-13 02:17 | - | |
| ![[DIR]](/icons/folder.gif) | jasper-initramfs/ | 2024-02-18 03:15 | - | |
| ![[DIR]](/icons/folder.gif) | jasmin-sable/ | 2025-01-30 14:50 | - | |
| ![[DIR]](/icons/folder.gif) | jas/ | 2025-01-29 08:35 | - | |
| ![[DIR]](/icons/folder.gif) | jas-plotter/ | 2025-01-29 08:35 | - | |
| ![[DIR]](/icons/folder.gif) | jarjar/ | 2022-05-12 01:34 | - | |
| ![[DIR]](/icons/folder.gif) | jarjar-maven-plugin/ | 2024-05-03 11:30 | - | |
| ![[DIR]](/icons/folder.gif) | jarisplayer/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jargs/ | 2020-07-03 01:23 | - | |
| ![[DIR]](/icons/folder.gif) | jargoninformatique/ | 2024-04-04 03:19 | - | |
| ![[DIR]](/icons/folder.gif) | jargon/ | 2024-11-07 08:17 | - | |
| ![[DIR]](/icons/folder.gif) | jargon-text/ | 2021-01-05 07:41 | - | |
| ![[DIR]](/icons/folder.gif) | jardiff/ | 2025-02-03 02:29 | - | |
| ![[DIR]](/icons/folder.gif) | jarchivelib/ | 2022-07-24 11:42 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.text/ | 2022-07-24 07:40 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.stream/ | 2025-02-11 19:24 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.itertools/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.context/ | 2022-06-23 06:51 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.collections/ | 2022-07-24 07:40 | - | |
| ![[DIR]](/icons/folder.gif) | jaraco.classes/ | 2024-08-15 19:54 | - | |
| ![[DIR]](/icons/folder.gif) | japitools/ | 2021-01-20 08:16 | - | |
| ![[DIR]](/icons/folder.gif) | japi-compliance-checker/ | 2022-11-17 20:20 | - | |
| ![[DIR]](/icons/folder.gif) | japa/ | 2024-04-04 21:28 | - | |
| ![[DIR]](/icons/folder.gif) | janus/ | 2025-07-27 15:35 | - | |
| ![[DIR]](/icons/folder.gif) | jansson/ | 2018-08-04 08:16 | - | |
| ![[DIR]](/icons/folder.gif) | jansi1/ | 2025-01-20 05:07 | - | |
| ![[DIR]](/icons/folder.gif) | jansi/ | 2024-02-15 21:38 | - | |
| ![[DIR]](/icons/folder.gif) | jansi-native/ | 2024-01-01 13:27 | - | |
| ![[DIR]](/icons/folder.gif) | janino/ | 2025-02-07 21:12 | - | |
| ![[DIR]](/icons/folder.gif) | janest-ocaml-compiler-libs/ | 2025-06-17 00:05 | - | |
| ![[DIR]](/icons/folder.gif) | janest-core/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | janest-core-kernel/ | 2018-02-02 08:17 | - | |
| ![[DIR]](/icons/folder.gif) | janest-core-extended/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | janest-base/ | 2025-08-31 21:03 | - | |
| ![[DIR]](/icons/folder.gif) | jane-street-headers/ | 2025-01-29 06:03 | - | |
| ![[DIR]](/icons/folder.gif) | jana/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jamulus/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jamnntpd/ | 2020-04-03 16:04 | - | |
| ![[DIR]](/icons/folder.gif) | jamm/ | 2023-11-22 19:35 | - | |
| ![[DIR]](/icons/folder.gif) | jaminid/ | 2018-03-26 10:04 | - | |
| ![[DIR]](/icons/folder.gif) | jamin/ | 2025-10-29 19:16 | - | |
| ![[DIR]](/icons/folder.gif) | jami/ | 2024-07-20 09:01 | - | |
| ![[DIR]](/icons/folder.gif) | jameica/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jameica-util/ | 2021-11-01 13:34 | - | |
| ![[DIR]](/icons/folder.gif) | jameica-h2database/ | 2024-06-19 07:39 | - | |
| ![[DIR]](/icons/folder.gif) | jameica-datasource/ | 2024-11-06 05:32 | - | |
| ![[DIR]](/icons/folder.gif) | jama/ | 2021-01-21 08:16 | - | |
| ![[DIR]](/icons/folder.gif) | jam/ | 2025-01-11 14:51 | - | |
| ![[DIR]](/icons/folder.gif) | jam-lib/ | 2024-11-01 05:01 | - | |
| ![[DIR]](/icons/folder.gif) | jalview/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jalv/ | 2024-04-06 21:48 | - | |
| ![[DIR]](/icons/folder.gif) | jaligner/ | 2023-07-17 09:14 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-validation-api/ | 2022-12-08 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-transaction-api/ | 2025-02-15 14:52 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-standard-taglib/ | 2025-04-09 07:13 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-servlet-api/ | 2024-08-07 02:22 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-mail/ | 2020-10-29 19:34 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-jsp-api/ | 2025-05-03 18:55 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-jmeter/ | 2021-10-20 02:32 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-interceptor-api/ | 2024-08-03 02:29 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-inject-api/ | 2025-02-15 14:52 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-el-api/ | 2022-12-08 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-ecs/ | 2016-11-03 21:09 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-cdi-api/ | 2025-02-15 14:52 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-authentication-api/ | 2025-02-15 14:52 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-annotation-api/ | 2022-12-08 19:30 | - | |
| ![[DIR]](/icons/folder.gif) | jakarta-activation/ | 2021-01-19 14:19 | - | |
| ![[DIR]](/icons/folder.gif) | jailtool/ | 2018-11-24 14:19 | - | |
| ![[DIR]](/icons/folder.gif) | jailkit/ | 2023-01-04 14:19 | - | |
| ![[DIR]](/icons/folder.gif) | jailer/ | 2016-11-01 02:28 | - | |
| ![[DIR]](/icons/folder.gif) | jags/ | 2023-05-02 21:09 | - | |
| ![[DIR]](/icons/folder.gif) | jag/ | 2025-02-10 09:46 | - | |
| ![[DIR]](/icons/folder.gif) | jaffl/ | 2018-01-22 16:50 | - | |
| ![[DIR]](/icons/folder.gif) | jadetex/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jade/ | 2016-04-08 23:18 | - | |
| ![[DIR]](/icons/folder.gif) | jacoco/ | 2024-05-06 22:04 | - | |
| ![[DIR]](/icons/folder.gif) | jacktrip/ | 2025-08-23 13:12 | - | |
| ![[DIR]](/icons/folder.gif) | jacksum/ | 2020-01-25 08:21 | - | |
| ![[DIR]](/icons/folder.gif) | jacksum-sugar/ | 2020-08-10 07:44 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-modules-java8/ | 2024-12-11 09:00 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-module-jaxb-annotations/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-module-afterburner/ | 2018-01-23 17:07 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-jr/ | 2022-11-13 13:44 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-jaxrs-providers/ | 2021-01-19 01:43 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-datatype-joda/ | 2024-01-18 19:25 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-datatype-guava/ | 2020-07-11 05:52 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-dataformat-yaml/ | 2025-10-29 23:06 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-dataformat-xml/ | 2022-11-13 13:44 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-dataformat-smile/ | 2021-11-06 08:18 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-dataformat-cbor/ | 2025-05-02 03:11 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-databind/ | 2025-01-27 21:11 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-core/ | 2022-12-21 20:34 | - | |
| ![[DIR]](/icons/folder.gif) | jackson-annotations/ | 2022-11-13 01:18 | - | |
| ![[DIR]](/icons/folder.gif) | jackrabbit/ | 2025-07-24 03:21 | - | |
| ![[DIR]](/icons/folder.gif) | jackmeter/ | 2023-10-28 21:15 | - | |
| ![[DIR]](/icons/folder.gif) | jackeq/ | 2020-04-04 21:53 | - | |
| ![[DIR]](/icons/folder.gif) | jackd2/ | 2025-10-02 15:33 | - | |
| ![[DIR]](/icons/folder.gif) | jackd-defaults/ | 2025-08-25 10:09 | - | |
| ![[DIR]](/icons/folder.gif) | jack/ | 2025-10-28 08:11 | - | |
| ![[DIR]](/icons/folder.gif) | jack-tools/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jack-stdio/ | 2024-02-25 14:54 | - | |
| ![[DIR]](/icons/folder.gif) | jack-rack/ | 2020-04-05 09:18 | - | |
| ![[DIR]](/icons/folder.gif) | jack-mixer/ | 2025-01-04 15:46 | - | |
| ![[DIR]](/icons/folder.gif) | jack-midi-clock/ | 2023-10-28 21:15 | - | |
| ![[DIR]](/icons/folder.gif) | jack-keyboard/ | 2025-10-29 15:29 | - | |
| ![[DIR]](/icons/folder.gif) | jack-example-tools/ | 2025-03-24 15:04 | - | |
| ![[DIR]](/icons/folder.gif) | jack-delay/ | 2020-12-30 07:34 | - | |
| ![[DIR]](/icons/folder.gif) | jack-capture/ | 2024-01-28 08:52 | - | |
| ![[DIR]](/icons/folder.gif) | jack-audio-connection-kit/ | 2025-08-19 02:12 | - | |
| ![[DIR]](/icons/folder.gif) | jacal/ | 2023-01-12 08:20 | - | |
| ![[DIR]](/icons/folder.gif) | jabsorb/ | 2025-02-14 08:54 | - | |
| ![[DIR]](/icons/folder.gif) | jabref/ | 2022-12-29 13:29 | - | |
| ![[DIR]](/icons/folder.gif) | jablicator/ | 2017-04-11 20:18 | - | |
| ![[DIR]](/icons/folder.gif) | jabberd2/ | 2025-03-24 02:59 | - | |
| ![[DIR]](/icons/folder.gif) | jabberbot/ | 2016-11-01 16:04 | - | |
| ![[DIR]](/icons/p.gif) | jabber.py/ | 2016-04-13 21:35 | - | |
| ![[DIR]](/icons/folder.gif) | jabber-querybot/ | 2021-01-10 01:51 | - | |
| ![[DIR]](/icons/folder.gif) | jabber-muc/ | 2025-07-08 02:32 | - | |
| ![[DIR]](/icons/folder.gif) | jabber-irc/ | 2016-11-01 09:15 | - | |
| ![[DIR]](/icons/folder.gif) | jaaa/ | 2024-04-04 21:28 | - | |
| ![[DIR]](/icons/folder.gif) | j4-dmenu-desktop/ | 2025-01-27 14:57 | - | |
| ![[DIR]](/icons/folder.gif) | j2cli/ | 2024-02-15 22:48 | - | |
curl -O https://mirror.coganng.com/addRepo.sh && sudo bash addRepo.shinto any bash Terminal. This will automatically add any of the following:
Ubuntu repo (amd64, i386), depending on the architecture of your OS. This should just work without any issues, and will choose the nearest mirror server to the server's location. If there are any issues or if you wish to restore the original sources.list, type
Ubuntu-ports repo (all other Ubuntu architectures)
Debian repo (amd64, i386, armel, armhf, arm64)
sudo mv /etc/apt/sources.list.tibak /etc/apt/sources.list
Note that you do not need to download any other addRepo-*.sh file. The addRepo.sh main script will do it for you.