![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| sysvinit/ | 2024-11-04 04:24 | - | |
| sysvbanner/ | 2024-04-20 04:21 | - | |
| sysv-rc-conf/ | 2022-12-29 10:19 | - | |
| systune/ | 2024-05-27 07:51 | - | |
| systray-mdstat/ | 2020-12-29 22:12 | - | |
| systraq/ | 2023-05-08 16:13 | - | |
| systemtap/ | 2024-08-29 10:16 | - | |
| systemsettings/ | 2024-11-04 22:18 | - | |
| systempreferences.app/ | 2024-09-16 22:20 | - | |
| systemfixtures/ | 2024-08-25 10:14 | - | |
| systemd/ | 2024-11-21 04:23 | - | |
| systemd-el/ | 2024-07-26 13:26 | - | |
| systemd-cron/ | 2024-08-19 16:13 | - | |
| systemd-bootchart/ | 2024-11-04 16:17 | - | |
| systemd-boot-installer/ | 2024-11-11 10:23 | - | |
| systemc/ | 2024-07-31 10:16 | - | |
| systembridgemodels/ | 2024-11-15 16:21 | - | |
| system-tools-backends/ | 2024-11-07 04:19 | - | |
| system-packages-el/ | 2024-07-31 10:16 | - | |
| system-config-printer/ | 2024-11-04 16:17 | - | |
| sysstat/ | 2024-11-04 16:17 | - | |
| sysrqd/ | 2024-11-04 16:17 | - | |
| sysrepo/ | 2024-09-08 22:27 | - | |
| sysprofile/ | 2023-03-31 16:25 | - | |
| sysprof/ | 2024-11-21 16:35 | - | |
| sysnews/ | 2024-10-28 19:42 | - | |
| syslog-summary/ | 2024-11-17 22:21 | - | |
| syslog-ocaml/ | 2024-08-20 10:14 | - | |
| syslog-ng/ | 2024-10-25 22:29 | - | |
| syslog-nagios-bridge/ | 2024-04-16 10:19 | - | |
| syslinux/ | 2023-06-13 16:46 | - | |
| sysfsutils/ | 2024-11-04 16:17 | - | |
| sysdig/ | 2024-10-22 10:14 | - | |
| sysconftool/ | 2024-04-16 04:32 | - | |
| sysconfig/ | 2024-11-19 21:50 | - | |
| sysbench/ | 2024-11-22 02:42 | - | |
| syrthes/ | 2024-04-21 22:17 | - | |
| syrep/ | 2024-11-04 16:17 | - | |
| synthv1/ | 2024-11-19 10:15 | - | |
| synphot/ | 2024-11-20 22:54 | - | |
| synopsis/ | 2024-04-20 04:23 | - | |
| synfigstudio/ | 2024-11-06 22:23 | - | |
| synfig/ | 2024-08-02 04:24 | - | |
| syndie/ | 2023-12-05 04:22 | - | |
| syndication/ | 2024-11-04 16:17 | - | |
| syndication-domination/ | 2024-11-15 22:18 | - | |
| syncthingtray/ | 2024-11-20 12:04 | - | |
| syncthing/ | 2024-10-10 10:33 | - | |
| syncthing-gtk/ | 2024-03-20 06:07 | - | |
| syncplay/ | 2024-05-17 10:20 | - | |
| syncmaildir/ | 2024-11-12 04:17 | - | |
| syncevolution/ | 2024-11-04 16:17 | - | |
| syncany/ | 2022-10-21 22:19 | - | |
| syncache/ | 2024-05-25 17:06 | - | |
| synaptic/ | 2024-11-04 16:17 | - | |
| synapse/ | 2024-11-06 22:23 | - | |
| synadm/ | 2024-04-16 10:17 | - | |
| sympy/ | 2024-11-09 04:17 | - | |
| sympow/ | 2024-11-04 16:17 | - | |
| sympathy/ | 2024-10-28 19:42 | - | |
| sympa/ | 2024-11-05 16:18 | - | |
| symmetrize/ | 2023-12-01 22:21 | - | |
| symmetrica/ | 2024-11-05 16:19 | - | |
| symlinks/ | 2024-10-28 19:42 | - | |
| symfpu/ | 2022-11-17 04:50 | - | |
| symfony/ | 2024-11-20 04:15 | - | |
| symfit/ | 2024-07-04 10:14 | - | |
| symeig/ | 2012-03-30 10:40 | - | |
| sylseg-sk/ | 2024-06-11 08:20 | - | |
| sylpheed/ | 2024-08-14 22:19 | - | |
| sylpheed-doc/ | 2023-04-28 16:14 | - | |
| sylph-searcher/ | 2024-11-07 04:19 | - | |
| syllabipy/ | 2022-12-08 10:25 | - | |
| sylfilter/ | 2024-11-04 16:17 | - | |
| sxmo-utils/ | 2024-11-04 16:18 | - | |
| sxiv/ | 2024-11-07 04:17 | - | |
| sxiv-el/ | 2024-07-26 13:26 | - | |
| sxid/ | 2024-10-28 19:41 | - | |
| sxhkd/ | 2024-10-28 19:41 | - | |
| sx/ | 2024-04-20 10:17 | - | |
| swupdate/ | 2024-11-12 04:17 | - | |
| swugenerator/ | 2024-05-16 06:12 | - | |
| swtpm/ | 2024-11-08 10:14 | - | |
| swtchart/ | 2023-04-30 22:14 | - | |
| swtcalendar/ | 2023-03-29 10:19 | - | |
| swt4-gtk/ | 2024-08-06 10:15 | - | |
| swt-paperclips/ | 2023-03-29 10:19 | - | |
| sword/ | 2024-09-17 10:15 | - | |
| sword-text-web/ | 2023-04-30 04:23 | - | |
| sword-text-sparv/ | 2023-04-30 04:23 | - | |
| sword-text-kjv/ | 2023-04-30 04:23 | - | |
| sword-dict-strongs-hebrew/ | 2023-10-06 02:25 | - | |
| sword-dict-strongs-greek/ | 2023-04-30 04:23 | - | |
| sword-dict-naves/ | 2023-10-06 02:25 | - | |
| sword-comm-tdavid/ | 2023-04-30 04:23 | - | |
| sword-comm-scofield/ | 2023-04-30 04:23 | - | |
| sword-comm-mhcc/ | 2023-10-06 02:25 | - | |
| switchsh/ | 2024-10-28 19:41 | - | |
| switcheroo-control/ | 2024-11-04 16:17 | - | |
| switchconf/ | 2024-05-26 05:39 | - | |
| switchbot-api/ | 2024-08-04 04:35 | - | |
| swisswatch/ | 2024-11-04 16:17 | - | |
| swissknife/ | 2023-04-28 10:16 | - | |
| swish-e/ | 2024-10-25 22:30 | - | |
| swish++/ | 2024-10-28 19:41 | - | |
| swirc/ | 2024-11-18 10:14 | - | |
| swing-layout/ | 2020-12-28 20:49 | - | |
| swiglpk/ | 2024-11-15 22:18 | - | |
| swig/ | 2024-11-04 16:17 | - | |
| swiftsc/ | 2021-01-22 04:16 | - | |
| swiftlang/ | 2024-11-03 01:06 | - | |
| swift/ | 2024-11-07 10:17 | - | |
| swift-tools/ | 2024-02-01 04:49 | - | |
| swift-im/ | 2024-08-07 16:21 | - | |
| swift-bench/ | 2024-03-15 10:21 | - | |
| swi-prolog/ | 2024-11-14 19:23 | - | |
| swi-prolog-doc/ | 2019-03-24 16:30 | - | |
| swh-plugins/ | 2024-10-30 06:53 | - | |
| swh-lv2/ | 2024-10-30 06:57 | - | |
| swfmill/ | 2024-11-10 16:16 | - | |
| swell-foop/ | 2024-11-04 16:17 | - | |
| sweethome3d/ | 2024-10-09 10:19 | - | |
| sweethome3d-textures-editor/ | 2023-04-28 16:13 | - | |
| sweethome3d-furniture/ | 2023-04-28 04:20 | - | |
| sweethome3d-furniture-editor/ | 2023-04-28 10:15 | - | |
| sweeper/ | 2024-11-07 20:20 | - | |
| sweep/ | 2024-04-17 16:19 | - | |
| sweed/ | 2024-10-28 19:41 | - | |
| swedish/ | 2024-04-30 22:17 | - | |
| swe-standard-data/ | 2021-01-05 01:50 | - | |
| swe-data/ | 2023-03-27 10:23 | - | |
| swaylock/ | 2024-08-31 22:49 | - | |
| swaykbdd/ | 2024-10-28 19:41 | - | |
| swayimg/ | 2024-10-28 10:18 | - | |
| swayidle/ | 2024-10-28 19:41 | - | |
| swaybg/ | 2024-11-04 16:17 | - | |
| sway/ | 2024-11-04 10:23 | - | |
| sway-notification-center/ | 2024-11-04 16:17 | - | |
| sway-contrib/ | 2024-05-02 04:24 | - | |
| swauth/ | 2023-05-04 22:12 | - | |
| swath/ | 2024-10-28 14:08 | - | |
| swatch/ | 2023-04-28 04:19 | - | |
| swarp/ | 2024-11-07 04:19 | - | |
| swarm-cluster/ | 2024-11-04 16:17 | - | |
| swapspace/ | 2024-11-04 16:18 | - | |
| swappy/ | 2024-11-07 10:18 | - | |
| swap-cwm/ | 2016-03-05 17:26 | - | |
| swaml/ | 2023-05-01 04:18 | - | |
| swami/ | 2024-11-04 16:17 | - | |
| swaks/ | 2024-01-06 00:11 | - | |
| swagger-spec-validator/ | 2024-07-04 10:14 | - | |
| swagger-core/ | 2021-01-27 04:12 | - | |
| swac-get/ | 2024-04-15 16:21 | - | |
| svxlink/ | 2024-10-05 10:23 | - | |
| svtplay-dl/ | 2024-08-04 09:35 | - | |
| svtools/ | 2024-07-11 06:36 | - | |
| svt-av1/ | 2024-10-01 22:19 | - | |
| svnmailer/ | 2023-03-29 16:21 | - | |
| svnkit/ | 2023-04-30 22:15 | - | |
| svnclientadapter/ | 2023-03-30 10:19 | - | |
| svn2git/ | 2023-05-01 22:15 | - | |
| svn2cl/ | 2023-04-09 22:43 | - | |
| svn-workbench/ | 2023-04-28 10:14 | - | |
| svn-load/ | 2023-04-28 10:15 | - | |
| svn-buildpackage/ | 2023-04-30 16:14 | - | |
| svn-all-fast-export/ | 2024-11-07 04:19 | - | |
| svim/ | 2022-12-29 10:19 | - | |
| svgwrite/ | 2023-05-02 16:12 | - | |
| svgtune/ | 2023-10-09 23:22 | - | |
| svgsalamander/ | 2023-05-03 04:20 | - | |
| svgpp/ | 2023-06-13 16:47 | - | |
| svgpart/ | 2024-11-07 10:18 | - | |
| sushi/ | 2024-04-16 10:21 | - | |
| survivor/ | 2024-01-16 04:22 | - | |
| survival/ | 2024-11-05 16:19 | - | |
| survex/ | 2024-10-28 10:18 | - | |
| suru-icon-theme/ | 2024-10-22 10:15 | - | |
| surpyvor/ | 2021-11-10 04:25 | - | |
| suricata/ | 2024-10-24 22:16 | - | |
| suricata-update/ | 2024-05-17 02:59 | - | |
| surgescript/ | 2024-11-06 22:22 | - | |
| surfraw/ | 2023-04-28 10:17 | - | |
| surf/ | 2024-10-11 04:28 | - | |
| surf-display/ | 2018-08-24 10:21 | - | |
| surf-alggeo/ | 2024-11-04 16:17 | - | |
| surepy/ | 2024-08-24 22:16 | - | |
| surefire/ | 2024-10-24 21:23 | - | |
| surankco/ | 2023-10-05 17:20 | - | |
| supysonic/ | 2024-07-29 10:56 | - | |
| supybot/ | 2023-04-30 04:22 | - | |
| supple/ | 2024-04-20 04:21 | - | |
| supervisor/ | 2024-09-08 10:15 | - | |
| supertuxkart/ | 2024-11-19 16:14 | - | |
| supertux/ | 2024-11-04 16:17 | - | |
| supertransball2/ | 2024-10-28 19:41 | - | |
| superqt/ | 2024-07-26 10:41 | - | |
| supernovas/ | 2024-11-09 10:27 | - | |
| supermin/ | 2024-10-23 16:16 | - | |
| superlu/ | 2024-10-09 22:24 | - | |
| superlu-dist/ | 2024-11-17 00:43 | - | |
| superkb/ | 2024-11-07 04:19 | - | |
| superiotool/ | 2024-04-17 22:16 | - | |
| supercollider/ | 2024-11-06 22:21 | - | |
| supercollider-sc3-plugins/ | 2024-11-04 16:17 | - | |
| supercat/ | 2024-10-28 19:41 | - | |
| super/ | 2024-10-28 19:41 | - | |
| super-save-el/ | 2024-08-03 10:15 | - | |
| super-csv/ | 2023-10-03 18:49 | - | |
| sup/ | 2024-11-06 16:16 | - | |
| sup-mail/ | 2024-07-20 22:20 | - | |
| sunxi-tools/ | 2024-08-18 10:14 | - | |
| sunweg/ | 2024-10-10 10:33 | - | |
| sunpy/ | 2024-11-22 04:24 | - | |
| sunpy-sphinx-theme/ | 2024-10-24 23:34 | - | |
| sunpinyin/ | 2024-11-06 22:22 | - | |
| sunflow/ | 2023-04-29 10:19 | - | |
| sundials/ | 2024-11-21 10:28 | - | |
| sunclock/ | 2024-11-04 16:17 | - | |
| sump-logicanalyzer/ | 2011-07-27 15:17 | - | |
| sumo/ | 2024-11-12 22:20 | - | |
| sumatra/ | 2024-04-20 22:24 | - | |
| sumalibs/ | 2024-01-16 04:23 | - | |
| sumaclust/ | 2024-04-20 22:24 | - | |
| suitesparse/ | 2024-11-04 10:24 | - | |
| suitesparse-graphblas/ | 2024-11-08 10:14 | - | |
| suitename/ | 2024-10-28 19:41 | - | |
| suil/ | 2024-11-06 16:16 | - | |
| suggest-el/ | 2024-07-26 13:26 | - | |
| sugarplum/ | 2023-03-29 10:18 | - | |
| sugarjar/ | 2024-05-07 10:26 | - | |
| sugar/ | 2024-02-06 17:49 | - | |
| sugar-write-activity/ | 2023-04-29 04:14 | - | |
| sugar-toolkit-gtk3/ | 2024-11-06 22:21 | - | |
| sugar-terminal-activity/ | 2023-05-02 04:18 | - | |
| sugar-read-activity/ | 2024-07-02 23:20 | - | |
| sugar-pippy-activity/ | 2024-02-06 18:39 | - | |
| sugar-memorize-activity/ | 2024-02-06 18:07 | - | |
| sugar-log-activity/ | 2023-05-02 04:18 | - | |
| sugar-jukebox-activity/ | 2023-05-08 16:13 | - | |
| sugar-imageviewer-activity/ | 2023-05-08 16:13 | - | |
| sugar-datastore/ | 2024-11-04 16:17 | - | |
| sugar-chat-activity/ | 2023-04-28 16:15 | - | |
| sugar-calculate-activity/ | 2023-05-02 04:18 | - | |
| sugar-browse-activity/ | 2024-02-11 04:54 | - | |
| sugar-base/ | 2024-04-20 04:22 | - | |
| sugar-artwork/ | 2024-04-20 04:22 | - | |
| suede/ | 2023-05-01 16:14 | - | |
| suds/ | 2024-10-13 10:19 | - | |
| sudoku/ | 2024-10-28 19:41 | - | |
| sudoku-solver/ | 2024-11-07 04:19 | - | |
| sudo/ | 2024-11-19 10:15 | - | |
| sucrack/ | 2024-11-04 16:17 | - | |
| suckless-tools/ | 2024-10-28 14:08 | - | |
| suck/ | 2024-10-24 22:17 | - | |
| subvertpy/ | 2024-11-03 16:18 | - | |
| subversion/ | 2024-11-15 22:18 | - | |
| subuser/ | 2018-12-27 10:33 | - | |
| subunit/ | 2024-11-05 04:26 | - | |
| subtle/ | 2024-04-17 10:26 | - | |
| subtitleeditor/ | 2024-11-07 04:18 | - | |
| subtitlecomposer/ | 2024-11-07 16:20 | - | |
| subread/ | 2024-09-05 10:14 | - | |
| subprocess-tee/ | 2023-01-12 10:23 | - | |
| subnetcalc/ | 2024-11-07 04:18 | - | |
| sublist3r/ | 2023-07-27 23:10 | - | |
| subliminal/ | 2024-07-05 05:53 | - | |
| sublime-music/ | 2024-05-07 04:47 | - | |
| sublib/ | 2023-03-29 10:19 | - | |
| subethasmtp/ | 2017-12-22 03:00 | - | |
| subdownloader/ | 2023-04-30 10:15 | - | |
| subcommander/ | 2024-04-17 22:16 | - | |
| subarch-select/ | 2023-08-09 10:24 | - | |
| styx/ | 2024-04-17 10:28 | - | |
| stymulator/ | 2024-04-28 22:21 | - | |
| stylish-haskell/ | 2024-08-25 22:28 | - | |
| stylebook/ | 2023-05-08 16:13 | - | |
| stx2any/ | 2023-03-29 10:18 | - | |
| stx-btree/ | 2024-04-17 22:16 | - | |
| stunnel4/ | 2024-10-30 06:57 | - | |
| stun/ | 2024-11-06 22:21 | - | |
| stumpwm/ | 2023-05-01 16:14 | - | |
| stterm/ | 2024-10-03 22:19 | - | |
| stsci.tools/ | 2024-09-25 10:14 | - | |
| stsci.distutils/ | 2023-03-29 22:22 | - | |
| structured-logging-clojure/ | 2023-02-14 10:20 | - | |
| structure-synth/ | 2024-11-07 10:17 | - | |
| strucchange/ | 2024-09-10 22:17 | - | |
| strophejs/ | 2023-04-28 16:14 | - | |
| strophejs-plugin-rsm/ | 2022-11-29 10:33 | - | |
| strophejs-plugin-mam/ | 2021-08-25 10:18 | - | |
| strophejs-plugin-chatstates/ | 2021-04-18 16:07 | - | |
| strongswan/ | 2024-11-04 16:17 | - | |
| striprtf/ | 2024-11-20 22:21 | - | |
| strip-nondeterminism/ | 2024-05-24 17:52 | - | |
| stringtie/ | 2024-11-06 22:21 | - | |
| stringtemplate4/ | 2024-10-14 10:16 | - | |
| stringtemplate/ | 2023-10-16 15:49 | - | |
| stringencoders/ | 2024-11-06 22:22 | - | |
| string-template-maven-plugin/ | 2023-09-06 23:25 | - | |
| stretchplayer/ | 2024-11-07 04:19 | - | |
| stressapptest/ | 2024-11-07 04:18 | - | |
| stressant/ | 2023-02-10 02:08 | - | |
| stress/ | 2024-10-28 14:08 | - | |
| stress-ng/ | 2024-11-06 04:18 | - | |
| streamtuner2/ | 2024-06-14 19:50 | - | |
| streamripper/ | 2024-08-11 10:20 | - | |
| streamlink/ | 2024-11-20 16:16 | - | |
| streamex/ | 2022-12-23 10:39 | - | |
| streamdeck-ui/ | 2021-12-29 04:17 | - | |
| stream-zip/ | 2024-10-19 16:17 | - | |
| stream-lib/ | 2019-10-17 22:28 | - | |
| strcase/ | 2020-08-28 04:17 | - | |
| strawberry/ | 2024-10-03 10:14 | - | |
| straight.plugin/ | 2024-09-14 10:15 | - | |
| strace/ | 2024-11-19 18:19 | - | |
| stow/ | 2024-10-30 06:57 | - | |
| storymaps/ | 2023-04-28 10:17 | - | |
| stormlib/ | 2024-10-28 19:41 | - | |
| stormbaancoureur/ | 2024-11-06 16:16 | - | |
| storm/ | 2024-11-18 04:24 | - | |
| storm-lang/ | 2024-11-21 10:27 | - | |
| storebackup/ | 2023-05-05 16:10 | - | |
| stopwatch/ | 2023-03-29 16:20 | - | |
| stopt/ | 2024-07-30 10:20 | - | |
| stops/ | 2023-04-28 04:19 | - | |
| stopmotion/ | 2024-09-04 10:42 | - | |
| stookwijzer/ | 2024-10-18 10:15 | - | |
| stookalert/ | 2024-08-10 10:16 | - | |
| stone/ | 2024-04-04 16:13 | - | |
| stompserver/ | 2024-02-22 07:07 | - | |
| stomper/ | 2024-01-10 10:15 | - | |
| stoken/ | 2024-11-04 16:17 | - | |
| stockpile-clojure/ | 2021-01-07 04:34 | - | |
| stockfish/ | 2024-04-20 16:16 | - | |
| stm32flash/ | 2024-10-28 14:08 | - | |
| stlink/ | 2024-08-15 10:28 | - | |
| stlcmd/ | 2024-10-28 19:41 | - | |
| stl-manual/ | 2023-03-29 10:20 | - | |
| stk/ | 2024-11-04 16:17 | - | |
| stimfit/ | 2024-04-21 04:51 | - | |
| stiff/ | 2024-10-28 14:07 | - | |
| stgit/ | 2024-09-08 17:07 | - | |
| stfl/ | 2024-10-26 04:24 | - | |
| stex/ | 2024-07-04 10:14 | - | |
| stevedore/ | 2024-10-16 04:23 | - | |
| steptalk/ | 2024-11-04 16:17 | - | |
| stepic/ | 2023-04-28 16:13 | - | |
| step/ | 2024-08-05 22:25 | - | |
| step.js/ | 2022-01-11 16:15 | - | |
| stenographer/ | 2024-10-23 10:17 | - | |
| stencil-clojure/ | 2018-03-28 10:42 | - | |
| stenc/ | 2024-10-28 19:41 | - | |
| stellarsolver/ | 2024-08-05 22:25 | - | |
| stellarium/ | 2024-09-30 04:15 | - | |
| stella/ | 2024-10-15 11:12 | - | |
| stegsnow/ | 2024-11-04 16:17 | - | |
| stegseek/ | 2024-10-30 06:50 | - | |
| stegosuite/ | 2023-04-28 04:21 | - | |
| steghide/ | 2024-04-20 16:16 | - | |
| stegcracker/ | 2024-03-23 11:07 | - | |
| steam-installer/ | 2024-10-04 21:38 | - | |
| stealth/ | 2024-10-28 19:40 | - | |
| ste-plugins/ | 2024-10-31 04:22 | - | |
| stdx-allocator/ | 2023-02-10 04:23 | - | |
| stdsyslog/ | 2024-08-31 10:17 | - | |
| stdio-mgr/ | 2024-09-15 22:17 | - | |
| stdgpu/ | 2024-11-02 22:45 | - | |
| stdeb/ | 2024-08-09 12:20 | - | |
| stda/ | 2021-01-06 02:23 | - | |
| stayrtr/ | 2024-10-23 16:16 | - | |
| stax/ | 2024-11-07 04:17 | - | |
| stax-ex/ | 2023-04-30 22:15 | - | |
| statsvn/ | 2023-04-28 10:16 | - | |
| statsprocessor/ | 2024-10-31 04:22 | - | |
| statsmodels/ | 2024-11-20 04:15 | - | |
| statserial/ | 2024-10-28 19:40 | - | |
| statnews/ | 2023-03-29 10:19 | - | |
| staticsite/ | 2024-08-27 10:15 | - | |
| statcvs/ | 2024-11-17 21:27 | - | |
| starvoyager/ | 2024-11-17 22:22 | - | |
| startup-notification/ | 2024-07-15 22:18 | - | |
| startpar/ | 2024-11-04 16:17 | - | |
| starpy/ | 2023-04-28 10:16 | - | |
| starpu/ | 2024-11-14 10:32 | - | |
| starplot/ | 2024-04-16 16:22 | - | |
| starman/ | 2023-10-06 06:43 | - | |
| starlink-pal/ | 2024-10-11 10:15 | - | |
| starlink-ast/ | 2024-10-12 10:15 | - | |
| starlette/ | 2024-11-21 23:27 | - | |
| starlet/ | 2023-03-29 16:22 | - | |
| starjava-votable/ | 2024-11-19 21:05 | - | |
| starjava-vo/ | 2024-11-20 01:19 | - | |
| starjava-util/ | 2024-11-19 21:05 | - | |
| starjava-ttools/ | 2024-11-20 23:26 | - | |
| starjava-topcat/ | 2024-11-20 17:36 | - | |
| starjava-tjoin/ | 2024-10-21 10:28 | - | |
| starjava-tfcat/ | 2024-10-18 10:15 | - | |
| starjava-task/ | 2024-10-13 20:08 | - | |
| starjava-table/ | 2024-11-19 21:05 | - | |
| starjava-registry/ | 2024-10-13 00:14 | - | |
| starjava-pal/ | 2024-10-13 00:14 | - | |
| starjava-fits/ | 2024-10-18 10:15 | - | |
| starjava-ecsv/ | 2024-10-18 10:15 | - | |
| starjava-dpac/ | 2024-10-13 00:14 | - | |
| starjava-datanode/ | 2024-10-21 10:28 | - | |
| starjava-connect/ | 2024-10-13 00:14 | - | |
| starjava-cdf/ | 2024-10-12 23:55 | - | |
| starjava-auth/ | 2024-11-19 21:05 | - | |
| starjava-array/ | 2024-10-12 23:55 | - | |
| starfighter/ | 2024-10-28 19:40 | - | |
| stardicter/ | 2024-01-15 05:48 | - | |
| stardict/ | 2024-08-24 10:15 | - | |
| stardict-xmlittre/ | 2021-12-07 06:50 | - | |
| stardict-czech/ | 2024-11-14 09:22 | - | |
| stardata-common/ | 2024-04-20 04:21 | - | |
| standardskriver/ | 2019-11-19 22:29 | - | |
| stalonetray/ | 2024-10-30 06:57 | - | |
| stalin/ | 2024-10-28 19:40 | - | |
| staden/ | 2024-11-07 04:17 | - | |
| staden-io-lib/ | 2024-11-04 16:17 | - | |
| stactools/ | 2024-06-06 04:16 | - | |
| stackview/ | 2024-07-01 22:18 | - | |
| stacks/ | 2024-09-08 10:15 | - | |
| stacer/ | 2024-07-21 22:20 | - | |
| stac-validator/ | 2024-10-19 10:16 | - | |
| stac-check/ | 2024-11-14 10:33 | - | |
| st/ | 2024-04-22 04:15 | - | |
| st-console/ | 2024-09-18 01:06 | - | |
| ssvnc/ | 2024-10-05 10:24 | - | |
| sstp-client/ | 2024-08-12 10:27 | - | |
| ssss/ | 2024-10-28 19:40 | - | |
| ssshtest/ | 2022-06-02 10:21 | - | |
| sssd/ | 2024-09-08 10:15 | - | |
| ssreflect/ | 2024-11-21 12:05 | - | |
| sspace/ | 2023-04-30 04:24 | - | |
| ssocr/ | 2024-07-13 10:32 | - | |
| ssmtp/ | 2024-10-09 16:23 | - | |
| ssmping/ | 2024-04-20 04:21 | - | |
| ssm/ | 2024-11-04 16:17 | - | |
| sslstrip/ | 2011-08-18 10:28 | - | |
| sslsplit/ | 2024-11-04 16:17 | - | |
| sslsniff/ | 2024-09-16 22:20 | - | |
| sslscan/ | 2024-10-27 10:12 | - | |
| sslh/ | 2024-10-26 10:18 | - | |
| ssldump/ | 2024-11-04 16:17 | - | |
| ssl-utils-clojure/ | 2023-12-03 15:34 | - | |
| ssl-cert/ | 2024-08-04 18:19 | - | |
| ssl-cert-check/ | 2023-05-01 04:17 | - | |
| sshuttle/ | 2024-10-13 10:20 | - | |
| sshtunnel/ | 2022-06-05 09:48 | - | |
| sshpubkeys/ | 2024-06-03 06:05 | - | |
| sshpass/ | 2024-11-04 16:17 | - | |
| sshguard/ | 2024-09-18 22:23 | - | |
| sshfs-fuse/ | 2024-11-04 16:17 | - | |
| sshfp/ | 2023-04-30 10:15 | - | |
| sshesame/ | 2024-10-23 16:16 | - | |
| sshcommand/ | 2021-05-06 01:48 | - | |
| ssh-tools/ | 2024-10-23 16:16 | - | |
| ssh-import-id/ | 2023-05-02 10:13 | - | |
| ssh-cron/ | 2024-10-28 19:40 | - | |
| ssh-contact/ | 2024-04-16 04:31 | - | |
| ssh-audit/ | 2024-11-06 10:32 | - | |
| ssh-askpass/ | 2024-11-05 16:20 | - | |
| ssh-askpass-fullscreen/ | 2024-11-04 16:17 | - | |
| ssh-agent-filter/ | 2024-11-04 16:17 | - | |
| ssft/ | 2023-04-29 22:17 | - | |
| ssed/ | 2024-04-17 16:18 | - | |
| ssdeep/ | 2024-11-06 22:22 | - | |
| sscg/ | 2024-11-04 16:17 | - | |
| ssake/ | 2024-07-03 20:49 | - | |
| srv-el/ | 2024-07-26 14:37 | - | |
| srt/ | 2024-11-19 10:15 | - | |
| srst2/ | 2024-06-19 10:14 | - | |
| srslte/ | 2024-04-22 04:16 | - | |
| srpc/ | 2024-10-08 10:20 | - | |
| srm-ifce/ | 2024-11-07 22:23 | - | |
| srg/ | 2024-10-28 19:40 | - | |
| srf/ | 2024-04-20 22:24 | - | |
| sreview/ | 2024-08-24 10:15 | - | |
| sredird/ | 2024-06-10 22:13 | - | |
| srecord/ | 2024-11-07 04:18 | - | |
| srcpd/ | 2024-10-06 10:21 | - | |
| src2tex/ | 2024-06-17 22:11 | - | |
| sratom/ | 2024-11-06 22:22 | - | |
| srain/ | 2024-08-24 10:15 | - | |
| sra-sdk/ | 2024-11-21 10:27 | - | |
| sqwebmail-de/ | 2023-04-30 10:14 | - | |
| squizz/ | 2024-10-28 19:40 | - | |
| squishyball/ | 2024-04-27 22:47 | - | |
| squirrel3/ | 2024-11-04 16:17 | - | |
| squidview/ | 2024-10-28 19:40 | - | |
| squidtaild/ | 2022-04-21 10:34 | - | |
| squidguard/ | 2024-11-04 16:17 | - | |
| squid/ | 2024-11-04 16:17 | - | |
| squid-langpack/ | 2023-04-30 16:13 | - | |
| squid-deb-proxy/ | 2024-10-25 04:35 | - | |
| squeezelite/ | 2024-08-05 22:21 | - | |
| squeekboard/ | 2024-11-20 10:15 | - | |
| squeak-vm/ | 2024-04-20 16:16 | - | |
| squashfuse/ | 2024-11-04 16:17 | - | |
| squashfs-tools/ | 2024-10-30 06:52 | - | |
| squashfs-tools-ng/ | 2024-10-08 10:20 | - | |
| squashfs-mount/ | 2024-08-29 10:16 | - | |
| squareness/ | 2023-04-28 16:13 | - | |
| squaremap/ | 2021-02-12 10:12 | - | |
| sqsh/ | 2024-04-20 22:23 | - | |
| sqlsmith/ | 2024-11-04 16:17 | - | |
| sqlreduce/ | 2024-01-30 21:21 | - | |
| sqlparse/ | 2024-11-21 22:13 | - | |
| sqlobject/ | 2024-07-03 17:06 | - | |
| sqlmodel/ | 2024-07-17 10:34 | - | |
| sqlmap/ | 2024-11-16 10:17 | - | |
| sqlline/ | 2023-04-28 16:13 | - | |
| sqlkit/ | 2019-03-28 04:28 | - | |
| sqljet/ | 2021-01-02 02:48 | - | |
| sqliteodbc/ | 2024-11-06 22:22 | - | |
| sqlitedict/ | 2022-12-11 10:32 | - | |
| sqlitecpp/ | 2024-02-13 04:19 | - | |
| sqlitebrowser/ | 2024-09-06 10:15 | - | |
| sqlite3/ | 2024-11-12 22:20 | - | |
| sqlite3-pcre/ | 2024-04-17 04:13 | - | |
| sqlite/ | 2024-04-20 16:15 | - | |
| sqlite-utils/ | 2024-11-21 22:13 | - | |
| sqlite-modern-cpp/ | 2024-07-25 14:01 | - | |
| sqlite-fts4/ | 2022-12-12 10:24 | - | |
| sqlgrey/ | 2024-06-04 09:55 | - | |
| sqlglot/ | 2024-11-21 22:15 | - | |
| sqlfluff/ | 2024-11-20 22:21 | - | |
| sqlcipher/ | 2024-11-12 04:16 | - | |
| sqlalchemy/ | 2024-11-17 04:19 | - | |
| sqlalchemy-utc/ | 2024-05-26 19:27 | - | |
| sqlalchemy-i18n/ | 2024-11-14 14:50 | - | |
| sqlacodegen/ | 2024-07-17 10:34 | - | |
| sql-ledger/ | 2023-04-30 04:24 | - | |
| sqitch/ | 2024-10-26 10:20 | - | |
| spyne/ | 2024-10-17 10:15 | - | |
| spymemcached/ | 2023-02-27 01:21 | - | |
| spyder/ | 2024-05-11 10:13 | - | |
| spyder-unittest/ | 2023-07-27 02:19 | - | |
| spyder-reports/ | 2024-10-25 04:35 | - | |
| spyder-memory-profiler/ | 2021-02-08 08:05 | - | |
| spyder-line-profiler/ | 2024-01-07 10:16 | - | |
| spyder-kernels/ | 2023-12-21 10:16 | - | |
| spview/ | 2023-06-13 09:53 | - | |
| sputnik/ | 2022-11-19 02:38 | - | |
| spullara-cli-parser/ | 2021-01-09 22:19 | - | |
| sptk/ | 2024-10-28 19:40 | - | |
| sptag/ | 2024-07-09 16:16 | - | |
| sprox/ | 2023-03-29 22:21 | - | |
| sprng/ | 2024-09-03 10:16 | - | |
| springlobby/ | 2024-10-06 10:21 | - | |
| spring/ | 2024-10-05 10:22 | - | |
| spread-sheet-widget/ | 2024-11-04 16:17 | - | |
| spread-phy/ | 2023-04-30 16:15 | - | |
| sprai/ | 2024-09-04 22:17 | - | |
| spout/ | 2024-11-04 16:17 | - | |
| spotweb/ | 2023-03-29 16:20 | - | |
| spotlighter/ | 2024-11-04 16:17 | - | |
| spotipy/ | 2024-08-04 04:35 | - | |
| spopt/ | 2024-07-12 16:16 | - | |
| spooles/ | 2024-07-10 22:17 | - | |
| spock/ | 2023-04-29 22:17 | - | |
| spoa/ | 2024-11-04 16:17 | - | |
| spnavcfg/ | 2024-07-03 01:19 | - | |
| sploitscan/ | 2024-10-10 10:34 | - | |
| splix/ | 2024-09-28 10:17 | - | |
| splitvt/ | 2024-08-24 22:17 | - | |
| splitpatch/ | 2024-02-22 13:19 | - | |
| splint/ | 2024-10-28 19:40 | - | |
| spline/ | 2024-10-28 19:40 | - | |
| splay/ | 2024-09-10 10:19 | - | |
| splat/ | 2024-04-22 10:18 | - | |
| splash/ | 2024-09-22 10:17 | - | |
| spl-linux/ | 2024-04-23 04:21 | - | |
| spkproxy/ | 2023-03-29 16:19 | - | |
| spirv-tools/ | 2024-10-22 22:23 | - | |
| spirv-llvm-translator/ | 2022-10-12 10:21 | - | |
| spirv-llvm-translator-19/ | 2024-09-23 22:20 | - | |
| spirv-llvm-translator-18/ | 2024-09-22 10:17 | - | |
| spirv-llvm-translator-17/ | 2024-09-21 10:32 | - | |
| spirv-llvm-translator-15/ | 2024-09-15 22:20 | - | |
| spirv-llvm-translator-14/ | 2024-09-13 22:15 | - | |
| spirv-headers/ | 2024-10-24 10:15 | - | |
| spirv-cross/ | 2024-10-01 22:19 | - | |
| spiped/ | 2024-11-04 16:17 | - | |
| spip/ | 2024-11-15 23:06 | - | |
| spinner/ | 2024-10-28 19:40 | - | |
| spinner-el/ | 2024-07-26 13:26 | - | |
| spin/ | 2024-10-04 22:20 | - | |
| spim/ | 2024-11-09 10:27 | - | |
| spigot/ | 2024-10-28 19:40 | - | |
| spidev/ | 2024-11-15 22:18 | - | |
| spice/ | 2024-11-04 16:17 | - | |
| spice-vdagent/ | 2024-08-04 10:16 | - | |
| spice-protocol/ | 2023-04-30 10:15 | - | |
| spice-html5/ | 2023-04-28 04:21 | - | |
| spice-gtk/ | 2024-11-04 16:17 | - | |
| spi-tools/ | 2024-10-28 19:40 | - | |
| sphinxygen/ | 2023-11-14 10:12 | - | |
| sphinxtrain/ | 2024-11-07 04:19 | - | |
| sphinxtesters/ | 2024-03-08 10:17 | - | |
| sphinxsearch/ | 2024-11-04 16:17 | - | |
| sphinxext-rediraffe/ | 2023-03-26 22:27 | - | |
| sphinxext-opengraph/ | 2023-01-29 10:19 | - | |
| sphinxcontrib-websupport/ | 2024-08-30 10:14 | - | |
| sphinxcontrib-trio/ | 2023-11-05 20:21 | - | |
| sphinxcontrib-towncrier/ | 2024-05-15 22:17 | - | |
| sphinxcontrib-svg2pdfconverter/ | 2023-01-25 10:25 | - | |
| sphinxcontrib-spelling/ | 2023-05-02 04:17 | - | |
| sphinxcontrib-serializinghtml/ | 2024-08-24 10:15 | - | |
| sphinxcontrib-seqdiag/ | 2024-08-04 23:49 | - | |
| sphinxcontrib-restbuilder/ | 2024-11-08 20:22 | - | |
| sphinxcontrib-qthelp/ | 2024-08-05 10:16 | - | |
| sphinxcontrib-programoutput/ | 2024-09-18 10:17 | - | |
| sphinxcontrib-phpdomain/ | 2024-02-14 10:18 | - | |
| sphinxcontrib-pecanwsme/ | 2023-08-25 00:37 | - | |
| sphinxcontrib-openapi/ | 2024-11-19 15:20 | - | |
| sphinxcontrib-nwdiag/ | 2024-08-11 16:18 | - | |
| sphinxcontrib-moderncmakedomain/ | 2024-06-01 10:15 | - | |
| sphinxcontrib-mermaid/ | 2024-10-26 04:26 | - | |
| sphinxcontrib-log-cabinet/ | 2024-02-29 18:14 | - | |
| sphinxcontrib-jsmath/ | 2021-12-05 10:20 | - | |
| sphinxcontrib-jquery/ | 2023-12-18 16:12 | - | |
| sphinxcontrib-images/ | 2023-03-28 16:18 | - | |
| sphinxcontrib-httpdomain/ | 2024-05-07 10:26 | - | |
| sphinxcontrib-htmlhelp/ | 2024-08-17 04:20 | - | |
| sphinxcontrib-github-alt/ | 2024-05-12 10:17 | - | |
| sphinxcontrib-emojicodes/ | 2024-05-12 16:13 | - | |
| sphinxcontrib-doxylink/ | 2023-05-01 04:18 | - | |
| sphinxcontrib-docbookrestapi/ | 2023-04-28 16:14 | - | |
| sphinxcontrib-ditaa/ | 2023-01-09 22:32 | - | |
| sphinxcontrib-devhelp/ | 2024-08-30 10:15 | - | |
| sphinxcontrib-blockdiag/ | 2024-08-05 01:04 | - | |
| sphinxcontrib-bibtex/ | 2024-01-30 04:20 | - | |
| sphinxcontrib-autoprogram/ | 2024-06-08 10:15 | - | |
| sphinxcontrib-asyncio/ | 2023-08-03 20:49 | - | |
| sphinxcontrib-applehelp/ | 2021-11-28 22:21 | - | |
| sphinxcontrib-actdiag/ | 2024-08-05 01:40 | - | |
| sphinxbase/ | 2024-11-21 04:23 | - | |
| sphinx/ | 2024-11-17 20:04 | - | |
| sphinx-theme-builder/ | 2024-10-13 10:19 | - | |
| sphinx-thebe/ | 2024-08-25 16:13 | - | |
| sphinx-testing/ | 2024-03-31 22:56 | - | |
| sphinx-tabs/ | 2023-11-04 10:19 | - | |
| sphinx-sitemap/ | 2024-08-22 02:37 | - | |
| sphinx-rtd-theme/ | 2024-11-22 04:24 | - | |
| sphinx-rst-builder/ | 2021-10-09 20:32 | - | |
| sphinx-reredirects/ | 2023-06-15 10:14 | - | |
| sphinx-removed-in/ | 2024-08-29 04:21 | - | |
| sphinx-remove-toctrees/ | 2024-06-22 16:13 | - | |
| sphinx-qt-documentation/ | 2022-11-22 10:17 | - | |
| sphinx-prompt/ | 2024-09-19 10:36 | - | |
| sphinx-press-theme/ | 2021-11-27 16:21 | - | |
| sphinx-patchqueue/ | 2015-11-17 11:09 | - | |
| sphinx-paramlinks/ | 2023-08-17 06:57 | - | |
| sphinx-panels/ | 2024-03-05 16:23 | - | |
| sphinx-notfound-page/ | 2024-08-08 10:33 | - | |
| sphinx-multiversion/ | 2022-10-06 22:17 | - | |
| sphinx-mdinclude/ | 2024-11-21 05:20 | - | |
| sphinx-markdown-tables/ | 2022-08-12 10:17 | - | |
| sphinx-jinja2-compat/ | 2024-09-18 22:21 | - | |
| sphinx-issuetracker/ | 2023-04-28 16:14 | - | |
| sphinx-intl/ | 2024-04-20 10:16 | - | |
| sphinx-inline-tabs/ | 2023-06-13 09:53 | - | |
| sphinx-hoverxref/ | 2024-10-11 10:15 | - | |
| sphinx-gallery/ | 2024-06-24 10:15 | - | |
| sphinx-favicon/ | 2023-05-16 22:15 | - | |
| sphinx-design/ | 2024-09-29 22:18 | - | |
| sphinx-copybutton/ | 2024-08-22 10:21 | - | |
| sphinx-code-tabs/ | 2024-08-02 22:19 | - | |
| sphinx-click/ | 2024-02-16 10:18 | - | |
| sphinx-celery/ | 2024-05-24 10:14 | - | |
| sphinx-bootstrap-theme/ | 2024-06-17 16:11 | - | |
| sphinx-book-theme/ | 2024-03-08 10:17 | - | |
| sphinx-basic-ng/ | 2023-08-13 19:20 | - | |
| sphinx-autorun/ | 2022-06-10 03:06 | - | |
| sphinx-automodapi/ | 2024-09-20 10:15 | - | |
| sphinx-autodoc-typehints/ | 2024-09-14 10:16 | - | |
| sphinx-autobuild/ | 2024-09-11 21:27 | - | |
| sphinx-autoapi/ | 2024-10-06 10:20 | - | |
| sphinx-astropy/ | 2023-06-23 01:22 | - | |
| sphinx-argparse/ | 2024-09-12 10:15 | - | |
| sphinx-argparse-cli/ | 2024-09-20 10:15 | - | |
| sphinx-a4doc/ | 2024-11-14 10:32 | - | |
| spherepack/ | 2024-07-15 10:17 | - | |
| sphde/ | 2024-11-07 04:18 | - | |
| spglib/ | 2024-11-18 22:20 | - | |
| spfft/ | 2024-11-03 04:50 | - | |
| spf-engine/ | 2024-07-15 10:16 | - | |
| spew/ | 2024-04-22 22:27 | - | |
| spellutils/ | 2024-10-28 19:39 | - | |
| spell/ | 2024-10-28 14:07 | - | |
| spek/ | 2024-08-03 10:15 | - | |
| speg/ | 2024-04-21 04:50 | - | |
| speexdsp/ | 2024-11-06 22:22 | - | |
| speex/ | 2024-11-06 22:22 | - | |
| speedtest-cli/ | 2023-05-02 10:13 | - | |
| speedpad/ | 2016-02-07 11:31 | - | |
| speedometer/ | 2024-01-08 13:36 | - | |
| speedcrunch/ | 2024-11-07 04:19 | - | |
| speechpy-fast/ | 2023-10-19 10:17 | - | |
| speechd-up/ | 2024-10-30 06:51 | - | |
| speechd-el/ | 2023-03-30 22:23 | - | |
| speech-tools/ | 2024-11-07 04:17 | - | |
| speech-dispatcher/ | 2024-11-11 04:38 | - | |
| specutils/ | 2024-11-11 10:23 | - | |
| spectrwm/ | 2024-08-08 10:33 | - | |
| spectrum2/ | 2024-10-05 10:23 | - | |
| spectre-meltdown-checker/ | 2023-08-19 18:00 | - | |
| spectral/ | 2022-06-01 22:32 | - | |
| spectral-cube/ | 2024-06-12 04:18 | - | |
| spectra/ | 2023-06-14 14:04 | - | |
| spectools/ | 2024-11-06 04:18 | - | |
| specter-clojure/ | 2021-01-07 04:49 | - | |
| spectacle/ | 2023-03-31 16:25 | - | |
| specreduce/ | 2024-06-26 16:16 | - | |
| specreduce-data/ | 2022-08-07 10:22 | - | |
| spec-alpha-clojure/ | 2023-02-06 10:23 | - | |
| speakup/ | 2023-04-28 10:16 | - | |
| speakup-tools/ | 2024-03-22 09:43 | - | |
| speaklater/ | 2023-03-29 10:20 | - | |
| spe/ | 2023-03-30 10:20 | - | |
| spdylay/ | 2024-04-22 22:30 | - | |
| spdx-licenses/ | 2024-11-08 04:17 | - | |
| spdlog/ | 2024-11-15 22:19 | - | |
| spd/ | 2024-10-30 06:54 | - | |
| spawn-fcgi/ | 2024-11-01 10:28 | - | |
| spatialite/ | 2024-11-07 10:18 | - | |
| spatialite-tools/ | 2024-11-06 22:21 | - | |
| spatialite-gui/ | 2024-11-04 16:17 | - | |
| spatialindex/ | 2024-11-06 10:32 | - | |
| spatial4j/ | 2023-04-30 10:16 | - | |
| spatial4j-0.4/ | 2023-04-30 10:15 | - | |
| spass/ | 2024-01-15 22:20 | - | |
| sparskit/ | 2024-04-20 16:15 | - | |
| sparsehash/ | 2020-05-03 10:21 | - | |
| sparse/ | 2024-11-04 16:17 | - | |
| sparql-wrapper-python/ | 2024-06-29 22:44 | - | |
| sparkline-php/ | 2023-03-29 10:19 | - | |
| sparkleshare/ | 2023-04-30 04:23 | - | |
| spandsp/ | 2024-11-07 04:18 | - | |
| spamprobe/ | 2024-11-20 10:15 | - | |
| spampd/ | 2024-05-26 06:05 | - | |
| spamoracle/ | 2024-08-20 10:14 | - | |
| spambayes/ | 2023-05-04 10:12 | - | |
| spamassassin/ | 2024-06-16 10:20 | - | |
| spamassassin-heatu/ | 2022-10-14 03:40 | - | |
| spamass-milter/ | 2024-10-28 19:39 | - | |
| spaln/ | 2024-08-06 04:24 | - | |
| spaghetti/ | 2024-11-17 10:16 | - | |
| spades/ | 2024-10-02 15:35 | - | |
| spacezero/ | 2024-04-17 16:20 | - | |
| spacenavd/ | 2024-11-04 16:17 | - | |
| spacefm/ | 2024-09-21 10:32 | - | |
| spaced/ | 2024-11-04 16:17 | - | |
| spacebar/ | 2024-04-23 16:17 | - | |
| spacearyarya/ | 2024-08-13 22:19 | - | |
| sp800-90b-entropy-assessment/ | 2024-10-05 10:24 | - | |
| sozi/ | 2023-03-29 10:20 | - | |
| sox/ | 2024-10-10 10:33 | - | |
| sourcecodegen/ | 2016-03-06 17:45 | - | |
| source-highlight/ | 2024-11-07 04:18 | - | |
| source-extractor/ | 2024-09-05 04:22 | - | |
| soupsieve/ | 2024-08-20 10:15 | - | |
| soup-sharp/ | 2023-08-12 22:39 | - | |
| soundtouch/ | 2024-11-04 16:17 | - | |
| soundscaperenderer/ | 2024-11-13 10:18 | - | |
| soundmodem/ | 2024-11-07 04:17 | - | |
| soundmanager2/ | 2023-05-03 04:21 | - | |
| soundkonverter/ | 2024-11-10 16:16 | - | |
| soundgrain/ | 2023-09-13 20:55 | - | |
| soundcraft-utils/ | 2024-07-31 22:21 | - | |
| soundconverter/ | 2024-11-19 10:15 | - | |
| sound-theme-freedesktop/ | 2023-06-19 08:17 | - | |
| sound-juicer/ | 2024-11-04 16:17 | - | |
| sound-icons/ | 2023-05-08 16:13 | - | |
| sosreport/ | 2024-11-01 10:26 | - | |
| sosi2osm/ | 2024-04-20 16:16 | - | |
| sortsmill-tools/ | 2019-03-24 19:17 | - | |
| sortmerna/ | 2024-07-28 10:23 | - | |
| sortmail/ | 2024-11-06 22:22 | - | |
| sortedcontainers/ | 2023-05-02 16:11 | - | |
| sortedcollections/ | 2022-11-03 10:20 | - | |
| sorted-nearest/ | 2024-11-20 04:15 | - | |
| sortablejs/ | 2023-11-21 13:19 | - | |
| sortable-tablesort.js/ | 2024-01-10 10:16 | - | |
| sorl-thumbnail/ | 2023-11-25 04:44 | - | |
| sord/ | 2024-11-06 22:22 | - | |
| soqt/ | 2024-11-04 16:17 | - | |
| sopwith/ | 2024-11-21 10:28 | - | |
| sopv-gpgv/ | 2024-11-18 10:14 | - | |
| sopt/ | 2024-09-15 10:17 | - | |
| soplex/ | 2024-11-21 20:51 | - | |
| sope/ | 2024-10-24 10:15 | - | |
| sop-java/ | 2024-11-13 10:17 | - | |
| sooperlooper/ | 2024-04-20 10:17 | - | |
| sonos-websocket/ | 2024-08-11 05:01 | - | |
| sonnet/ | 2024-11-04 16:17 | - | |
| sonivox/ | 2024-11-06 22:22 | - | |
| sonic/ | 2024-10-30 06:57 | - | |
| sonic-visualiser/ | 2024-10-21 10:28 | - | |
| sonic-pi/ | 2024-09-20 10:14 | - | |
| songwrite/ | 2023-03-29 22:21 | - | |
| sonata/ | 2024-11-12 00:39 | - | |
| somfy-mylink-synergy/ | 2024-08-11 22:50 | - | |
| sombok/ | 2024-10-18 16:16 | - | |
| solvespace/ | 2024-11-04 16:18 | - | |
| solo1-cli/ | 2024-01-17 04:14 | - | |
| sollya/ | 2024-11-07 04:20 | - | |
| solid/ | 2024-11-04 16:17 | - | |
| solid-pop3d/ | 2024-10-28 19:39 | - | |
| solfege/ | 2024-11-06 22:22 | - | |
| solarwolf/ | 2023-03-29 10:18 | - | |
| solarpowerlog/ | 2024-11-04 16:17 | - | |
| solarized-emacs/ | 2024-08-03 10:15 | - | |
| solaar/ | 2024-08-07 23:13 | - | |
| soju/ | 2024-10-23 16:16 | - | |
| sogo/ | 2024-10-27 22:16 | - | |
| software-properties/ | 2024-07-02 22:19 | - | |
| softhsm2/ | 2024-05-06 10:18 | - | |
| softflowd/ | 2024-11-04 16:17 | - | |
| softether-vpn/ | 2024-06-20 22:26 | - | |
| softcatala-spell/ | 2023-05-04 10:14 | - | |
| sofia-sip/ | 2024-11-04 16:17 | - | |
| sofa-framework/ | 2024-04-21 22:16 | - | |
| socnetv/ | 2024-11-07 10:17 | - | |
| sockstat/ | 2024-10-28 19:39 | - | |
| socksio/ | 2024-03-02 06:47 | - | |
| socks4-server/ | 2024-04-20 10:17 | - | |
| sockperf/ | 2024-10-28 19:39 | - | |
| socklog/ | 2024-07-14 22:21 | - | |
| sockjs-client/ | 2015-12-11 23:17 | - | |
| socket/ | 2024-04-15 16:22 | - | |
| socket-wrapper/ | 2024-11-09 22:16 | - | |
| socket++/ | 2024-10-18 22:13 | - | |
| social-auth-core/ | 2024-06-16 10:20 | - | |
| social-auth-app-django/ | 2024-07-29 10:56 | - | |
| soci/ | 2024-11-06 22:22 | - | |
| socat/ | 2024-09-04 10:42 | - | |
| soapyuhd/ | 2024-07-28 10:26 | - | |
| soapysdr/ | 2024-11-04 16:17 | - | |
| soapyrtlsdr/ | 2024-11-04 16:17 | - | |
| soapyremote/ | 2024-11-04 16:18 | - | |
| soapyredpitaya/ | 2024-11-06 22:22 | - | |
| soapyosmo/ | 2024-11-07 04:19 | - | |
| soapyhackrf/ | 2024-11-06 22:22 | - | |
| soapybladerf/ | 2024-11-06 22:22 | - | |
| soapyaudio/ | 2024-11-04 16:17 | - | |
| soapyairspy/ | 2024-11-06 22:22 | - | |
| soapsnp/ | 2024-10-28 14:07 | - | |
| soapdenovo2/ | 2024-08-12 04:12 | - | |
| soapdenovo/ | 2023-05-01 22:15 | - | |
| soapaligner/ | 2021-01-22 10:14 | - | |
| so-synth-lv2/ | 2024-10-28 19:39 | - | |
| sntop/ | 2024-11-04 16:17 | - | |
| snpsift/ | 2024-10-15 16:17 | - | |
| snpomatic/ | 2024-10-30 06:52 | - | |
| snpeff/ | 2024-10-14 10:17 | - | |
| snp-sites/ | 2024-10-18 22:13 | - | |
| snowflake/ | 2024-10-23 16:16 | - | |
| snowdrop/ | 2024-11-04 16:17 | - | |
| snowballz/ | 2023-04-28 10:15 | - | |
| snowball/ | 2024-11-06 22:22 | - | |
| snowball-data/ | 2021-02-07 10:14 | - | |
| snow/ | 2023-04-30 22:13 | - | |
| snort/ | 2024-08-28 10:18 | - | |
| snooze/ | 2024-10-28 19:39 | - | |
| snoopy/ | 2024-11-04 16:17 | - | |
| snmptt/ | 2024-05-16 00:52 | - | |
| snmptrapfmt/ | 2024-11-04 16:17 | - | |
| snmpsim/ | 2023-04-30 04:22 | - | |
| sniproxy/ | 2024-11-04 16:17 | - | |
| snippy/ | 2023-12-27 10:23 | - | |
| snimpy/ | 2024-09-13 22:16 | - | |
| sniffles/ | 2024-04-22 10:18 | - | |
| sniffit/ | 2024-04-26 04:22 | - | |
| snibbetracker/ | 2024-07-21 22:16 | - | |
| sni-qt/ | 2024-04-19 22:20 | - | |
| sngrep/ | 2024-11-04 16:17 | - | |
| sng/ | 2024-11-04 16:17 | - | |
| snetz/ | 2014-06-20 20:00 | - | |
| snek/ | 2024-11-06 22:21 | - | |
| sndobj/ | 2024-11-04 16:17 | - | |
| sndio/ | 2024-08-13 22:24 | - | |
| sndfile-tools/ | 2024-11-04 16:17 | - | |
| snd/ | 2024-11-21 10:27 | - | |
| sncosmo/ | 2024-11-20 04:15 | - | |
| snarf/ | 2024-04-15 16:22 | - | |
| snapraid/ | 2024-11-04 16:17 | - | |
| snappy/ | 2024-11-04 16:17 | - | |
| snappy-tools/ | 2024-11-04 16:17 | - | |
| snappy-java/ | 2024-11-19 01:08 | - | |
| snapper/ | 2024-09-21 10:32 | - | |
| snapper-gui/ | 2023-06-17 00:41 | - | |
| snappea/ | 2024-04-19 22:20 | - | |
| snapd/ | 2024-10-23 22:31 | - | |
| snapd-glib/ | 2024-11-07 04:18 | - | |
| snapcast/ | 2024-11-04 16:17 | - | |
| snap7/ | 2024-11-04 16:17 | - | |
| snap/ | 2024-10-28 19:39 | - | |
| snap-aligner/ | 2024-11-04 16:17 | - | |
| snakeyaml/ | 2023-05-02 22:23 | - | |
| snakeyaml-engine/ | 2024-02-26 10:22 | - | |
| snakemake/ | 2024-10-13 10:19 | - | |
| snakefood/ | 2023-04-28 10:17 | - | |
| snake4/ | 2024-11-09 10:29 | - | |
| snack/ | 2024-11-04 16:17 | - | |
| snacc/ | 2024-04-26 04:23 | - | |
| snac2/ | 2024-11-21 10:27 | - | |
| sn/ | 2024-04-20 22:24 | - | |
| smuxi/ | 2024-09-06 10:14 | - | |
| smtube/ | 2024-11-07 10:17 | - | |
| smtpprox/ | 2023-08-27 04:22 | - | |
| smtpprox-loopprevent/ | 2023-08-27 04:22 | - | |
| smtpping/ | 2024-10-28 19:39 | - | |
| smstools/ | 2024-10-28 19:39 | - | |
| sms4you/ | 2024-06-19 10:14 | - | |
| smrtanalysis/ | 2024-04-02 19:34 | - | |
| smpq/ | 2024-10-28 19:39 | - | |
| smplayer/ | 2024-09-29 10:14 | - | |
| smplayer-themes/ | 2023-04-30 22:15 | - | |
| smpeg/ | 2024-11-07 04:18 | - | |
| smp-utils/ | 2024-10-28 19:39 | - | |
| smokeping/ | 2024-02-13 10:19 | - | |
| smokegen/ | 2024-04-20 04:21 | - | |
| smlsharp/ | 2022-08-12 10:17 | - | |
| smlnj/ | 2023-05-04 04:18 | - | |
| sml-mode/ | 2024-07-26 13:26 | - | |
| smiles-scripts/ | 2024-07-07 10:14 | - | |
| smifb2/ | 2024-09-29 16:14 | - | |
| smex/ | 2024-07-26 13:26 | - | |
| smenu/ | 2024-10-28 14:07 | - | |
| smemstat/ | 2024-11-04 16:17 | - | |
| smem/ | 2024-08-29 22:18 | - | |
| smcroute/ | 2024-11-04 16:17 | - | |
| smbus2/ | 2024-01-17 04:14 | - | |
| smbnetfs/ | 2024-11-04 16:17 | - | |
| smbmap/ | 2024-11-15 10:23 | - | |
| smbldap-tools/ | 2021-09-21 09:05 | - | |
| smbc/ | 2024-04-20 10:17 | - | |
| smb4k/ | 2024-11-07 10:17 | - | |
| smb2www/ | 2023-04-28 10:17 | - | |
| smash/ | 2023-03-30 22:23 | - | |
| smartypants/ | 2023-04-28 16:14 | - | |
| smarty4/ | 2024-10-19 04:18 | - | |
| smarty3/ | 2024-11-21 04:23 | - | |
| smarty-validate/ | 2023-04-30 16:14 | - | |
| smarty-lexer/ | 2023-05-04 10:12 | - | |
| smarty-gettext/ | 2023-05-01 22:16 | - | |
| smartmontools/ | 2024-10-30 06:51 | - | |
| smartlist/ | 2024-08-05 22:20 | - | |
| smartleia/ | 2021-04-21 10:11 | - | |
| smartdns/ | 2024-11-04 16:17 | - | |
| smart/ | 2024-04-20 04:23 | - | |
| smart-open/ | 2024-10-14 00:51 | - | |
| smart-notifier/ | 2023-08-30 13:07 | - | |
| smart-mode-line/ | 2024-07-26 13:25 | - | |
| smart-meter-texas/ | 2024-08-04 04:35 | - | |
| smalt/ | 2024-11-04 16:17 | - | |
| smalr/ | 2018-12-26 10:31 | - | |
| smallerc/ | 2024-09-02 10:25 | - | |
| sma/ | 2024-04-17 22:16 | - | |
| sm/ | 2024-11-05 16:18 | - | |
| sm-archive/ | 2024-04-20 04:21 | - | |
| slxfig/ | 2024-11-04 16:17 | - | |
| slwildcard/ | 2024-10-28 19:39 | - | |
| slurp/ | 2024-10-31 22:24 | - | |
| slurm/ | 2024-11-04 16:17 | - | |
| slurm-wlm/ | 2024-11-15 10:23 | - | |
| slurm-llnl/ | 2024-04-23 04:22 | - | |
| sluice/ | 2024-08-23 10:19 | - | |
| slugimage/ | 2023-04-30 10:15 | - | |
| sludge/ | 2024-11-04 16:17 | - | |
| slt/ | 2024-10-23 16:16 | - | |
| slsqlite/ | 2024-11-06 22:22 | - | |
| slrnface/ | 2024-11-05 16:20 | - | |
| slrn/ | 2024-11-04 16:17 | - | |
| slpvm/ | 2024-04-16 22:17 | - | |
| slowmovideo/ | 2024-04-22 16:23 | - | |
| slowloris/ | 2024-02-07 11:19 | - | |
| slowhttptest/ | 2024-11-04 16:17 | - | |
| slowaes/ | 2019-04-02 04:27 | - | |
| slop/ | 2024-10-28 14:06 | - | |
| slony1-2/ | 2024-11-08 10:15 | - | |
| slof/ | 2023-05-02 16:11 | - | |
| sloccount/ | 2024-09-23 22:20 | - | |
| slm/ | 2024-10-21 05:30 | - | |
| slixmpp/ | 2024-11-19 22:15 | - | |
| slixmpp-omemo/ | 2024-10-27 10:12 | - | |
| slirp4netns/ | 2024-11-04 16:17 | - | |
| slirp/ | 2024-10-28 19:39 | - | |
| slinkwatch/ | 2024-10-23 16:16 | - | |
| slingshot/ | 2023-03-31 16:26 | - | |
| slingshot-clojure/ | 2023-05-02 10:13 | - | |
| slimit/ | 2024-08-26 22:19 | - | |
| slimevolley/ | 2024-10-28 19:38 | - | |
| slime/ | 2024-08-28 04:31 | - | |
| slimbox/ | 2021-01-07 02:37 | - | |
| slim/ | 2024-11-04 16:17 | - | |
| slidge/ | 2024-11-15 10:23 | - | |
| slidge-matridge/ | 2024-09-07 10:15 | - | |
| slides/ | 2023-03-29 10:19 | - | |
| slicot/ | 2024-11-04 16:17 | - | |
| slick/ | 2023-01-27 09:16 | - | |
| slick-greeter/ | 2024-11-04 16:17 | - | |
| slice/ | 2023-04-30 04:24 | - | |
| slic3r/ | 2024-11-21 14:19 | - | |
| slic3r-prusa/ | 2024-10-23 10:17 | - | |
| slib/ | 2023-03-30 22:25 | - | |
| slgsl/ | 2024-11-20 22:21 | - | |
| slgdbm/ | 2024-11-06 22:22 | - | |
| slexpat/ | 2024-10-28 19:38 | - | |
| sleuthkit/ | 2024-11-04 16:18 | - | |
| slepc4py/ | 2024-11-20 04:15 | - | |
| slepc/ | 2024-10-14 04:15 | - | |
| sleepyhead/ | 2024-04-20 16:15 | - | |
| sleepenh/ | 2024-04-21 04:50 | - | |
| sleepd/ | 2024-06-23 16:17 | - | |
| sleekxmpp/ | 2023-05-04 10:13 | - | |
| sleef/ | 2024-10-21 16:29 | - | |
| slcurl/ | 2024-11-04 16:17 | - | |
| slcfitsio/ | 2024-11-07 10:17 | - | |
| slbackup/ | 2023-05-02 22:25 | - | |
| slbackup-php/ | 2024-10-19 04:18 | - | |
| slay/ | 2023-04-28 04:20 | - | |
| slashtime/ | 2023-12-04 15:22 | - | |
| slashem/ | 2024-05-10 10:19 | - | |
| slapi-nis/ | 2024-11-04 16:17 | - | |
| slang2/ | 2024-11-04 16:17 | - | |
| slack/ | 2023-03-29 16:22 | - | |
| sl/ | 2024-10-28 19:38 | - | |
| skyview/ | 2024-07-11 10:33 | - | |
| skypat/ | 2024-11-07 04:17 | - | |
| skyfield/ | 2024-07-11 10:33 | - | |
| skycat/ | 2024-10-22 10:15 | - | |
| skstream/ | 2024-04-20 22:23 | - | |
| sks/ | 2024-07-21 22:19 | - | |
| sks-ecc/ | 2024-04-20 04:21 | - | |
| skrooge/ | 2024-11-07 22:24 | - | |
| skorch/ | 2024-10-30 06:54 | - | |
| skopeo/ | 2024-10-28 22:29 | - | |
| sklearn-pandas/ | 2024-02-22 10:52 | - | |
| skladnik/ | 2024-10-16 16:38 | - | |
| skktools/ | 2024-11-04 16:17 | - | |
| skksearch/ | 2024-11-04 16:17 | - | |
| skkdic/ | 2023-05-02 16:12 | - | |
| skinedit/ | 2024-11-04 16:17 | - | |
| skimage/ | 2024-11-19 22:15 | - | |
| skiboot/ | 2024-11-20 17:12 | - | |
| skewer/ | 2024-10-28 19:38 | - | |
| sketch/ | 2024-04-22 16:23 | - | |
| skesa/ | 2024-10-30 06:57 | - | |
| skeleton/ | 2020-12-31 23:50 | - | |
| skeema/ | 2024-10-24 22:15 | - | |
| skanpage/ | 2024-10-24 10:15 | - | |
| skanlite/ | 2024-11-07 04:20 | - | |
| skalibs/ | 2024-10-15 11:12 | - | |
| skales/ | 2024-05-19 22:22 | - | |
| ska/ | 2024-01-27 10:35 | - | |
| sjfonts/ | 2020-07-21 04:13 | - | |
| sjeng/ | 2024-06-22 10:15 | - | |
| sjacket-clojure/ | 2022-12-25 10:25 | - | |
| sjaakii/ | 2024-11-06 22:21 | - | |
| sizzle/ | 2023-11-19 21:46 | - | |
| sixer/ | 2023-12-23 10:25 | - | |
| six/ | 2024-08-08 04:23 | - | |
| sitesummary/ | 2024-04-04 10:29 | - | |
| sitemesh/ | 2023-04-30 04:23 | - | |
| sitecopy/ | 2024-10-13 22:18 | - | |
| sisu/ | 2023-11-01 10:50 | - | |
| sisu-plexus/ | 2023-04-28 10:15 | - | |
| sisu-mojos/ | 2023-01-16 03:20 | - | |
| sisu-maven-plugin/ | 2023-04-30 16:14 | - | |
| sisu-ioc/ | 2023-04-30 22:13 | - | |
| sisu-inject/ | 2023-04-28 10:15 | - | |
| sisu-guice/ | 2023-04-30 16:13 | - | |
| sispmctl/ | 2024-11-04 16:17 | - | |
| sisl/ | 2024-04-18 04:35 | - | |
| siscone/ | 2024-04-16 16:19 | - | |
| sisc/ | 2022-11-06 08:09 | - | |
| siril/ | 2024-09-30 04:16 | - | |
| sirikali/ | 2024-11-04 16:17 | - | |
| siridb-server/ | 2024-10-02 16:14 | - | |
| siridb-connector/ | 2022-09-16 06:12 | - | |
| sireader/ | 2024-08-22 17:19 | - | |
| sipxtapi/ | 2024-04-20 10:16 | - | |
| sipvicious/ | 2021-12-09 04:19 | - | |
| sipsak/ | 2024-11-04 16:17 | - | |
| siproxd/ | 2024-04-20 04:21 | - | |
| siphashc/ | 2024-11-15 22:18 | - | |
| sipgrep/ | 2024-11-07 04:18 | - | |
| sipcrack/ | 2024-11-04 16:17 | - | |
| sipcalc/ | 2024-10-28 19:38 | - | |
| sip6/ | 2024-07-18 10:18 | - | |
| sip5/ | 2021-01-18 16:11 | - | |
| sip4/ | 2024-10-30 06:53 | - | |
| sip-tester/ | 2024-09-26 10:16 | - | |
| sioyek/ | 2024-10-26 04:24 | - | |
| sinntp/ | 2023-03-29 10:19 | - | |
| singularity/ | 2020-07-16 10:19 | - | |
| singularity-music/ | 2020-07-27 15:03 | - | |
| singularity-container/ | 2024-10-23 16:16 | - | |
| singular/ | 2024-10-09 10:19 | - | |
| singledispatch/ | 2023-03-29 16:22 | - | |
| singleapplication/ | 2024-03-24 10:21 | - | |
| sinfo/ | 2024-11-04 16:18 | - | |
| since/ | 2024-10-28 19:38 | - | |
| simutrans/ | 2024-05-05 04:35 | - | |
| simutrans-pak128.britain/ | 2023-04-28 04:20 | - | |
| simutrans-pak64/ | 2023-04-28 04:20 | - | |
| simulpic/ | 2024-04-19 04:16 | - | |
| simulide/ | 2024-05-02 04:22 | - | |
| simulavr/ | 2024-11-04 16:17 | - | |
| simulate-event.js/ | 2023-10-13 16:17 | - | |
| simtools/ | 2023-09-04 22:20 | - | |
| simstring/ | 2024-10-28 19:38 | - | |
| simrisc/ | 2024-09-07 10:14 | - | |
| simplyhtml/ | 2023-04-29 10:18 | - | |
| simplisafe-python/ | 2024-09-15 22:17 | - | |
| simpletal/ | 2023-04-30 10:15 | - | |
| simplesnap/ | 2023-04-28 10:17 | - | |
| simplescreenrecorder/ | 2024-08-21 10:18 | - | |
| simplesamlphp/ | 2023-05-05 10:14 | - | |
| simpleproxy/ | 2024-04-17 16:16 | - | |
| simplepie/ | 2024-06-03 06:05 | - | |
| simplemonitor/ | 2024-08-08 10:32 | - | |
| simplemde-markdown-editor/ | 2018-02-12 10:46 | - | |
| simplematch/ | 2022-07-26 04:22 | - | |
| simplejson/ | 2024-11-15 22:18 | - | |
| simpleitk/ | 2022-11-08 22:18 | - | |
| simplegeneric/ | 2023-04-28 10:15 | - | |
| simpleeval/ | 2024-11-11 10:29 | - | |
| simplebayes/ | 2021-01-15 10:10 | - | |
| simple-xml/ | 2023-04-28 16:14 | - | |
| simple-whip-server/ | 2024-11-03 22:22 | - | |
| simple-whip-client/ | 2024-11-07 22:23 | - | |
| simple-tpm-pk11/ | 2024-11-04 16:17 | - | |
| simple-scan/ | 2024-11-04 16:17 | - | |
| simple-revision-control/ | 2024-02-18 14:37 | - | |
| simple-obfs/ | 2024-06-19 22:22 | - | |
| simple-image-reducer/ | 2023-04-30 16:13 | - | |
| simple-image-filter/ | 2024-11-07 04:19 | - | |
| simple-http/ | 2020-12-28 20:19 | - | |
| simple-cdd/ | 2023-05-04 16:13 | - | |
| simple-ccsm/ | 2024-09-16 10:20 | - | |
| simka/ | 2024-05-08 04:22 | - | |
| simile-timeline/ | 2023-04-30 10:16 | - | |
| similarity-tester/ | 2024-04-16 10:18 | - | |
| simhash/ | 2024-10-28 19:38 | - | |
| simh/ | 2024-06-17 22:11 | - | |
| simgrid/ | 2024-09-23 10:15 | - | |
| simgear/ | 2024-04-16 22:20 | - | |
| simdjson/ | 2024-10-26 10:18 | - | |
| simde/ | 2024-08-26 16:17 | - | |
| simbody/ | 2024-11-02 15:37 | - | |
| simba/ | 2023-04-30 16:13 | - | |
| simavr/ | 2024-05-10 10:20 | - | |
| simage/ | 2024-11-07 04:19 | - | |
| sim4/ | 2024-10-28 19:38 | - | |
| silx/ | 2024-11-19 22:14 | - | |
| silversearcher-ag/ | 2024-08-14 10:16 | - | |
| silversearcher-ag-el/ | 2024-09-12 11:18 | - | |
| silverjuke/ | 2024-11-04 16:17 | - | |
| silver-platter/ | 2024-10-01 04:13 | - | |
| silo-llnl/ | 2024-11-21 15:05 | - | |
| silly/ | 2024-11-04 16:17 | - | |
| silkaj/ | 2023-01-06 10:23 | - | |
| silentjack/ | 2024-04-20 04:21 | - | |
| silan/ | 2024-04-20 16:14 | - | |
| sigviewer/ | 2024-11-07 04:19 | - | |
| sigsum-go/ | 2024-10-17 10:16 | - | |
| sigscheme/ | 2024-09-21 22:33 | - | |
| sigrok/ | 2023-03-29 22:21 | - | |
| sigrok-firmware-fx2lafw/ | 2024-04-10 10:15 | - | |
| sigrok-cli/ | 2024-11-07 04:19 | - | |
| signond/ | 2024-11-11 04:38 | - | |
| signon-ui/ | 2024-11-07 04:20 | - | |
| signon-plugin-oauth2/ | 2024-11-07 04:20 | - | |
| signon-kwallet-extension/ | 2024-11-07 10:18 | - | |
| signing-party/ | 2024-10-28 19:38 | - | |
| signify/ | 2023-03-31 16:25 | - | |
| signify-openbsd/ | 2024-11-04 16:17 | - | |
| signify-openbsd-keys/ | 2024-08-25 10:14 | - | |
| signal-estimator/ | 2024-11-13 10:16 | - | |
| sigma-align/ | 2024-11-04 16:17 | - | |
| sigil/ | 2024-10-10 10:33 | - | |
| sight/ | 2024-08-24 22:18 | - | |
| siggen/ | 2024-04-21 22:17 | - | |
| sieve-connect/ | 2023-03-29 16:21 | - | |
| siege/ | 2024-11-04 16:17 | - | |
| sidplayfp/ | 2024-11-17 10:16 | - | |
| sidplay/ | 2024-10-28 19:38 | - | |
| sidplay-libs/ | 2024-04-19 22:20 | - | |
| sidplay-base/ | 2024-10-28 19:38 | - | |
| sidedoor/ | 2024-05-25 17:06 | - | |
| siconos/ | 2024-02-26 22:21 | - | |
| sickle/ | 2024-10-28 19:37 | - | |
| sic/ | 2024-10-28 19:37 | - | |
| sibsim4/ | 2024-10-28 19:37 | - | |
| sibelia/ | 2024-10-28 19:37 | - | |
| sia/ | 2024-10-23 10:17 | - | |
| shutter/ | 2024-04-03 20:55 | - | |
| shutdown-qapps/ | 2024-11-07 04:19 | - | |
| shutdown-at-night/ | 2023-06-13 16:46 | - | |
| shut-up/ | 2024-07-26 13:25 | - | |
| shush/ | 2024-10-28 19:37 | - | |
| shunit2/ | 2023-12-07 07:06 | - | |
| shtool/ | 2023-03-31 16:25 | - | |
| showq/ | 2024-04-16 04:29 | - | |
| show-in-file-manager/ | 2022-06-23 22:33 | - | |
| shovill/ | 2022-12-05 10:18 | - | |
| shove/ | 2022-12-16 16:17 | - | |
| should.js/ | 2023-03-31 16:26 | - | |
| shotwell/ | 2024-11-20 10:15 | - | |
| shotdetect/ | 2024-10-26 10:20 | - | |
| shotcut/ | 2024-11-21 10:56 | - | |
| shortuuid/ | 2024-05-26 21:19 | - | |
| shorewall6/ | 2023-05-04 10:13 | - | |
| shorewall6-lite/ | 2023-05-04 10:13 | - | |
| shorewall/ | 2024-08-01 10:19 | - | |
| shorewall-lite/ | 2023-05-04 10:13 | - | |
| shorewall-init/ | 2023-05-04 10:13 | - | |
| shorewall-doc/ | 2023-05-02 04:17 | - | |
| shorewall-core/ | 2023-05-04 10:13 | - | |
| shoogle/ | 2020-12-06 10:22 | - | |
| shogun/ | 2024-04-21 04:51 | - | |
| shogivar/ | 2024-11-04 16:17 | - | |
| shoelaces/ | 2024-10-23 16:16 | - | |
| shntool/ | 2024-08-29 22:18 | - | |
| shishi/ | 2024-11-04 16:17 | - | |
| shiro/ | 2023-04-29 10:18 | - | |
| shine/ | 2024-11-06 22:22 | - | |
| shimdandy/ | 2020-03-25 10:29 | - | |
| shim/ | 2024-09-03 22:22 | - | |
| shim-signed/ | 2024-09-03 22:22 | - | |
| shim-helpers-i386-signed/ | 2024-09-03 22:22 | - | |
| shim-helpers-arm64-signed/ | 2024-09-03 22:22 | - | |
| shim-helpers-amd64-signed/ | 2024-09-03 22:22 | - | |
| shiki-colors-murrine/ | 2021-02-07 19:22 | - | |
| shiboken/ | 2024-04-21 16:19 | - | |
| shibboleth-sp/ | 2024-11-05 04:24 | - | |
| shibboleth-resolver/ | 2024-11-04 16:17 | - | |
| shhopt/ | 2024-10-28 19:37 | - | |
| shhmsg/ | 2024-10-28 19:20 | - | |
| sherlock/ | 2024-07-19 10:23 | - | |
| shelxle/ | 2024-11-07 04:19 | - | |
| shelr/ | 2023-04-28 10:16 | - | |
| shelltestrunner/ | 2024-10-22 10:14 | - | |
| shellingham/ | 2023-10-31 10:14 | - | |
| shellinabox/ | 2024-11-04 16:17 | - | |
| shellia/ | 2024-02-10 10:41 | - | |
| shellex/ | 2024-10-28 19:20 | - | |
| shelldap/ | 2023-04-28 04:20 | - | |
| shellcheck/ | 2024-04-23 04:21 | - | |
| shell-utils-clojure/ | 2024-11-20 05:50 | - | |
| shedskin/ | 2019-03-29 04:28 | - | |
| shed/ | 2024-11-04 16:17 | - | |
| shc/ | 2024-04-17 10:27 | - | |
| shatag/ | 2023-05-08 16:13 | - | |
| shasta/ | 2024-11-04 16:17 | - | |
| sharutils/ | 2024-10-28 14:06 | - | |
| sharness/ | 2021-01-08 01:21 | - | |
| shared-mime-info/ | 2024-10-08 04:23 | - | |
| shards/ | 2024-04-20 10:16 | - | |
| shapetools/ | 2024-04-27 10:15 | - | |
| shapelib/ | 2024-08-22 10:21 | - | |
| shapeit4/ | 2024-11-06 22:21 | - | |
| shanty/ | 2020-12-26 05:49 | - | |
| shake/ | 2023-06-26 10:28 | - | |
| shairport-sync/ | 2024-11-04 16:17 | - | |
| shairplay/ | 2024-11-06 22:22 | - | |
| shadowsocks/ | 2023-06-13 16:47 | - | |
| shadowsocks-v2ray-plugin/ | 2024-07-01 22:18 | - | |
| shadowsocks-qt5/ | 2024-04-17 04:16 | - | |
| shadowsocks-libev/ | 2024-07-01 22:18 | - | |
| shadow/ | 2024-11-19 02:04 | - | |
| shaderc/ | 2024-10-21 18:35 | - | |
| shaarli/ | 2024-03-14 05:04 | - | |
| sgt-puzzles/ | 2024-11-04 16:17 | - | |
| sgrep/ | 2024-11-04 16:17 | - | |
| sgp4/ | 2024-01-17 16:14 | - | |
| sgmltools-lite/ | 2023-03-29 10:20 | - | |
| sgmllib3k/ | 2024-08-22 20:52 | - | |
| sgml2x/ | 2023-03-29 10:20 | - | |
| sgml-spell-checker/ | 2020-07-19 10:16 | - | |
| sgml-data/ | 2023-05-08 16:13 | - | |
| sgml-base/ | 2023-03-29 10:20 | - | |
| sgml-base-doc/ | 2023-03-31 16:25 | - | |
| sgf2dg/ | 2024-10-28 19:20 | - | |
| sgabios/ | 2023-04-28 10:17 | - | |
| sga/ | 2024-04-20 16:16 | - | |
| sg3-utils/ | 2024-11-04 16:17 | - | |
| sfxr-qt/ | 2024-11-04 16:17 | - | |
| sfwbar/ | 2024-11-06 22:20 | - | |
| sftpcloudfs/ | 2023-04-29 10:18 | - | |
| sfst/ | 2024-10-21 10:28 | - | |
| sfsexp/ | 2024-11-06 22:22 | - | |
| sfront/ | 2024-11-04 16:17 | - | |
| sfnt2woff-zopfli/ | 2024-10-28 19:20 | - | |
| sffview/ | 2024-11-04 16:17 | - | |
| sfftobmp/ | 2024-10-30 06:57 | - | |
| sfepy/ | 2024-08-26 22:19 | - | |
| sfeed/ | 2024-10-30 06:54 | - | |
| sfcgal/ | 2024-10-20 10:19 | - | |
| sfarkxtc/ | 2024-10-28 19:20 | - | |
| sfarklib/ | 2024-11-06 22:22 | - | |
| sezpoz/ | 2023-04-29 22:18 | - | |
| seyon/ | 2024-11-09 10:27 | - | |
| sextractor/ | 2024-04-20 10:17 | - | |
| sexpp/ | 2024-11-04 16:17 | - | |
| sexplib310/ | 2024-09-06 10:15 | - | |
| setzer/ | 2024-03-21 10:40 | - | |
| setuptools/ | 2024-10-24 20:10 | - | |
| setuptools-scm/ | 2024-06-14 10:20 | - | |
| setuptools-scm-git-archive/ | 2022-07-12 10:22 | - | |
| settle/ | 2024-10-24 10:14 | - | |
| setserial/ | 2024-11-15 10:23 | - | |
| setop/ | 2024-11-03 22:22 | - | |
| setools/ | 2024-11-21 22:15 | - | |
| setcover/ | 2024-01-17 16:14 | - | |
| setcolortemperature/ | 2024-04-19 22:20 | - | |
| setcd/ | 2024-11-04 16:17 | - | |
| setbfree/ | 2024-11-04 16:17 | - | |
| set-crontab-perl/ | 2023-04-28 10:14 | - | |
| session-token/ | 2023-12-19 10:25 | - | |
| sesman/ | 2024-07-26 13:25 | - | |
| servlet-api/ | 2019-01-18 10:36 | - | |
| servicelog/ | 2024-04-16 22:21 | - | |
| service-wrapper-java/ | 2024-04-19 22:20 | - | |
| serverspec-runner/ | 2023-10-09 22:20 | - | |
| servefile/ | 2024-10-21 02:36 | - | |
| serpent/ | 2024-09-08 15:19 | - | |
| serp/ | 2023-12-02 23:23 | - | |
| seriousproton/ | 2024-11-06 10:33 | - | |
| seriation/ | 2024-10-28 19:20 | - | |
| serialdv/ | 2024-11-06 22:22 | - | |
| serf/ | 2024-11-04 16:17 | - | |
| serd/ | 2024-11-04 16:18 | - | |
| ser2net/ | 2024-09-15 10:17 | - | |
| ser-player/ | 2024-10-17 22:24 | - | |
| sequitur-g2p/ | 2023-09-04 22:21 | - | |
| sequeler/ | 2024-11-06 22:23 | - | |
| seqtools/ | 2024-10-05 10:24 | - | |
| seqtk/ | 2024-10-30 06:54 | - | |
| seqsero/ | 2023-06-13 16:47 | - | |
| seqprep/ | 2024-11-07 04:17 | - | |
| seqmagick/ | 2024-08-12 10:20 | - | |
| seqkit/ | 2024-10-23 16:16 | - | |
| seqdiag/ | 2024-08-12 10:20 | - | |
| seqan3/ | 2024-11-20 22:21 | - | |
| seqan2/ | 2024-11-04 16:17 | - | |
| seqan/ | 2023-04-30 22:14 | - | |
| seqan-raptor/ | 2024-10-30 06:57 | - | |
| seqan-needle/ | 2024-11-17 10:16 | - | |
| seq24/ | 2024-04-17 10:27 | - | |
| seq-el/ | 2024-07-31 10:16 | - | |
| sepp/ | 2024-10-04 04:37 | - | |
| sepia/ | 2023-03-29 10:20 | - | |
| sep/ | 2024-11-20 04:15 | - | |
| sentry-python/ | 2024-11-21 22:15 | - | |
| sentinelsat/ | 2024-03-05 19:21 | - | |
| sentineldl/ | 2020-11-19 10:17 | - | |
| sentencepiece/ | 2024-11-16 10:16 | - | |
| sent/ | 2024-10-28 19:20 | - | |
| sensors-applet/ | 2024-11-06 04:19 | - | |
| sensorpush-ble/ | 2024-11-09 10:28 | - | |
| sensorpro-ble/ | 2024-08-29 22:19 | - | |
| sensor-state-data/ | 2024-07-03 10:14 | - | |
| sensible-utils/ | 2024-06-30 10:18 | - | |
| senpai/ | 2024-07-21 22:17 | - | |
| senlin/ | 2024-02-17 04:19 | - | |
| senlin-tempest-plugin/ | 2023-10-07 10:12 | - | |
| senlin-dashboard/ | 2024-03-19 10:30 | - | |
| sendxmpp/ | 2023-08-20 15:03 | - | |
| sendpage/ | 2021-01-09 00:36 | - | |
| sendmail/ | 2024-10-30 06:57 | - | |
| sendip/ | 2024-10-28 19:20 | - | |
| sendfile/ | 2024-11-10 16:16 | - | |
| sendemail/ | 2023-08-30 13:01 | - | |
| send2trash/ | 2024-11-22 04:24 | - | |
| sen/ | 2024-08-25 16:13 | - | |
| semver-clojure/ | 2021-02-07 10:14 | - | |
| semodule-utils/ | 2024-09-10 10:19 | - | |
| semi/ | 2023-05-02 16:11 | - | |
| selinux-python/ | 2024-09-22 10:17 | - | |
| selinux-gui/ | 2024-09-13 04:18 | - | |
| selinux-dbus/ | 2024-09-22 10:17 | - | |
| selinux-basics/ | 2023-08-24 22:44 | - | |
| selint/ | 2024-11-04 16:17 | - | |
| selektor/ | 2023-05-01 04:18 | - | |
| selectors34/ | 2023-05-03 04:20 | - | |
| select2.js/ | 2023-04-30 16:13 | - | |
| select-xface/ | 2023-05-02 16:12 | - | |
| seirsplus/ | 2024-05-29 23:55 | - | |
| segyio/ | 2024-04-21 16:20 | - | |
| segno/ | 2024-02-18 10:23 | - | |
| segment/ | 2023-04-28 10:15 | - | |
| segemehl/ | 2024-11-06 22:21 | - | |
| seergdb/ | 2024-11-04 16:17 | - | |
| seer/ | 2024-07-30 10:19 | - | |
| seekwatcher/ | 2024-04-16 16:18 | - | |
| seed-webkit2/ | 2024-04-21 16:20 | - | |
| see/ | 2024-04-17 04:13 | - | |
| sedutil/ | 2024-11-04 16:17 | - | |
| sedsed/ | 2023-09-07 17:49 | - | |
| sedparse/ | 2023-09-07 17:49 | - | |
| sed/ | 2024-11-04 16:17 | - | |
| securestring/ | 2024-11-15 22:19 | - | |
| securefs/ | 2024-10-06 17:22 | - | |
| secure-delete/ | 2024-11-04 16:17 | - | |
| secsipidx/ | 2024-10-23 16:16 | - | |
| secrets/ | 2024-09-12 10:15 | - | |
| secpanel/ | 2023-04-28 10:17 | - | |
| secnet/ | 2024-11-06 04:19 | - | |
| secilc/ | 2024-09-01 10:16 | - | |
| seccure/ | 2024-10-28 19:20 | - | |
| sec/ | 2024-11-10 22:17 | - | |
| seaview/ | 2024-11-04 16:17 | - | |
| seatd/ | 2024-11-05 10:24 | - | |
| seascope/ | 2023-03-29 16:21 | - | |
| searx/ | 2023-08-14 21:06 | - | |
| searx-admin/ | 2023-03-14 10:17 | - | |
| searchmonkey/ | 2024-11-04 16:17 | - | |
| searchandrescue/ | 2024-04-20 04:21 | - | |
| searchandrescue-data/ | 2024-04-02 21:49 | - | |
| search-citeseer/ | 2024-11-16 20:34 | - | |
| search-ccsb/ | 2024-06-09 17:05 | - | |
| seahorse/ | 2024-09-26 10:16 | - | |
| seahorse-nautilus/ | 2024-11-07 04:19 | - | |
| seahorse-adventures/ | 2023-12-12 17:51 | - | |
| seafile/ | 2024-11-20 22:22 | - | |
| seafile-client/ | 2024-11-20 22:21 | - | |
| seaborn/ | 2024-07-09 04:24 | - | |
| seabios/ | 2024-01-25 06:02 | - | |
| sdrangelove/ | 2024-04-21 04:51 | - | |
| sdpb/ | 2024-11-04 16:18 | - | |
| sdparm/ | 2024-11-04 16:17 | - | |
| sdpa/ | 2024-10-11 04:28 | - | |
| sdop/ | 2024-11-04 16:17 | - | |
| sdo-api-java/ | 2023-12-02 22:39 | - | |
| sdml/ | 2024-11-05 22:46 | - | |
| sdlpango/ | 2024-11-06 22:20 | - | |
| sdlgfx/ | 2024-11-06 22:22 | - | |
| sdlbasic/ | 2024-04-20 04:22 | - | |
| sdl12-compat/ | 2024-11-04 16:17 | - | |
| sdl2-compat/ | 2024-11-11 04:38 | - | |
| sdl-ttf2.0/ | 2024-11-06 22:22 | - | |
| sdl-stretch/ | 2023-04-28 10:17 | - | |
| sdl-sound1.2/ | 2024-11-04 22:18 | - | |
| sdl-net1.2/ | 2024-10-18 22:13 | - | |
| sdl-mixer1.2/ | 2024-08-03 10:15 | - | |
| sdl-kitchensink/ | 2024-08-06 04:23 | - | |
| sdl-image1.2/ | 2024-08-01 22:17 | - | |
| sdl-ball/ | 2024-10-24 10:15 | - | |
| sdkmanager/ | 2024-11-04 10:24 | - | |
| sdformat/ | 2024-11-05 16:18 | - | |
| sdf/ | 2023-08-02 10:39 | - | |
| sdes4j/ | 2021-01-09 21:34 | - | |
| sddm/ | 2024-10-30 06:52 | - | |
| sddm-kcm/ | 2024-11-04 16:17 | - | |
| sdcv/ | 2024-10-25 04:35 | - | |
| sdcc/ | 2024-11-04 16:17 | - | |
| sdbus-cpp/ | 2024-11-07 22:24 | - | |
| sdb/ | 2023-05-02 22:23 | - | |
| sdate/ | 2024-10-28 19:19 | - | |
| sdaps/ | 2024-04-22 16:25 | - | |
| sd-mux-ctrl/ | 2024-11-04 16:18 | - | |
| scythestat/ | 2023-04-28 10:15 | - | |
| scythe/ | 2024-11-04 16:17 | - | |
| scute/ | 2024-09-09 22:36 | - | |
| scummvm/ | 2024-10-09 10:19 | - | |
| scummvm-tools/ | 2024-11-04 16:17 | - | |
| sctk/ | 2024-04-23 10:22 | - | |
| scsitools/ | 2024-05-13 10:15 | - | |
| scscp-imcce/ | 2024-11-06 22:22 | - | |
| scrypt/ | 2024-11-20 10:15 | - | |
| scrub/ | 2024-11-07 22:23 | - | |
| scrounge-ntfs/ | 2024-11-04 16:17 | - | |
| scrot/ | 2024-11-07 16:25 | - | |
| scrollz/ | 2024-04-23 04:23 | - | |
| scrm/ | 2024-10-28 19:19 | - | |
| scriv/ | 2024-05-11 22:17 | - | |
| scriptaculous/ | 2024-10-19 18:04 | - | |
| scribus/ | 2024-08-22 22:33 | - | |
| scribus-template/ | 2024-01-18 19:20 | - | |
| scribus-ng/ | 2024-05-14 16:14 | - | |
| screentest/ | 2024-04-17 16:20 | - | |
| screenruler/ | 2023-11-13 01:04 | - | |
| screenkey/ | 2024-05-31 10:16 | - | |
| screeninfo/ | 2021-01-11 10:15 | - | |
| screenie/ | 2024-05-23 10:31 | - | |
| screengrab/ | 2024-09-22 21:04 | - | |
| screenfetch/ | 2023-04-30 04:24 | - | |
| screen/ | 2024-10-30 06:54 | - | |
| screen-message/ | 2024-11-16 10:17 | - | |
| scrcpy/ | 2024-01-17 10:20 | - | |
| scratch/ | 2023-04-28 10:17 | - | |
| scrappie/ | 2024-08-15 10:28 | - | |
| scrape-schema-recipe/ | 2023-02-02 10:17 | - | |
| scram/ | 2024-11-07 04:20 | - | |
| scowl/ | 2024-09-26 14:35 | - | |
| scout-clojure/ | 2023-05-02 10:13 | - | |
| scour/ | 2024-10-15 11:13 | - | |
| scottfree/ | 2024-10-28 14:05 | - | |
| scotch/ | 2024-11-21 22:49 | - | |
| scorched3d/ | 2024-11-04 16:17 | - | |
| scopt/ | 2018-11-17 22:40 | - | |
| scoop/ | 2023-04-30 10:16 | - | |
| scons/ | 2024-10-14 10:15 | - | |
| scons-doc/ | 2023-05-02 16:12 | - | |
| scolasync/ | 2024-11-18 10:14 | - | |
| scoary/ | 2024-10-22 10:14 | - | |
| scmxx/ | 2024-04-16 04:29 | - | |
| scmutils/ | 2023-02-07 04:18 | - | |
| scmail/ | 2021-02-07 18:51 | - | |
| scm/ | 2024-05-08 22:15 | - | |
| sclapp/ | 2019-03-28 04:28 | - | |
| scitokens-cpp/ | 2024-11-09 10:29 | - | |
| sciteproj/ | 2024-11-04 16:17 | - | |
| scite/ | 2024-10-30 06:54 | - | |
| scipy/ | 2024-11-22 03:09 | - | |
| sciplot/ | 2024-11-04 16:17 | - | |
| scim/ | 2024-11-06 22:21 | - | |
| scim-unikey/ | 2024-11-06 22:23 | - | |
| scim-thai/ | 2024-11-07 04:18 | - | |
| scim-tables/ | 2024-11-06 22:23 | - | |
| scim-skk/ | 2024-11-06 22:23 | - | |
| scim-pinyin/ | 2024-11-07 04:18 | - | |
| scim-m17n/ | 2024-11-06 22:22 | - | |
| scim-kmfl-imengine/ | 2024-06-18 04:22 | - | |
| scim-chewing/ | 2024-11-07 04:18 | - | |
| scim-canna/ | 2024-04-16 22:18 | - | |
| scim-anthy/ | 2024-11-06 22:23 | - | |
| scilab/ | 2024-10-17 10:16 | - | |
| scikit-rf/ | 2024-11-16 10:17 | - | |
| scikit-optimize/ | 2024-08-12 10:20 | - | |
| scikit-misc/ | 2024-11-19 04:26 | - | |
| scikit-learn/ | 2024-11-20 04:15 | - | |
| scikit-fmm/ | 2024-11-19 04:26 | - | |
| scikit-build/ | 2024-09-07 10:15 | - | |
| scikit-build-core/ | 2024-10-06 10:21 | - | |
| science.js/ | 2024-04-14 00:01 | - | |
| scid/ | 2024-10-28 19:37 | - | |
| scid-spell-data/ | 2022-04-25 05:21 | - | |
| scid-rating-data/ | 2022-04-25 02:36 | - | |
| schroot/ | 2024-09-12 10:15 | - | |
| schroedinger-maeparser/ | 2024-11-04 16:19 | - | |
| schroedinger-coordgenlibs/ | 2024-11-06 22:22 | - | |
| schoolkit/ | 2022-02-25 04:20 | - | |
| schleuder/ | 2024-08-20 16:13 | - | |
| schleuder-gitlab-ticketing/ | 2024-02-28 06:28 | - | |
| schleuder-cli/ | 2023-07-13 11:17 | - | |
| schism/ | 2024-11-19 10:15 | - | |
| scheme48/ | 2024-08-26 10:17 | - | |
| scheme9/ | 2024-04-22 04:17 | - | |
| scheme2c/ | 2019-03-28 04:35 | - | |
| scheme-bytestructures/ | 2024-10-20 10:19 | - | |
| schema2ldif/ | 2023-06-13 16:46 | - | |
| schedule/ | 2024-06-22 04:24 | - | |
| schedtool/ | 2024-11-04 16:17 | - | |
| sch-rnd/ | 2024-11-21 22:15 | - | |
| scgi/ | 2024-04-20 04:23 | - | |
| scdoc/ | 2024-11-06 22:22 | - | |
| sccache/ | 2024-10-21 10:28 | - | |
| scapy/ | 2024-11-17 10:15 | - | |
| scaphandre/ | 2024-10-23 16:16 | - | |
| scap-workbench/ | 2024-04-20 04:21 | - | |
| scap-security-guide/ | 2024-11-11 10:23 | - | |
| scantool/ | 2024-11-07 04:17 | - | |
| scantailor/ | 2024-04-20 04:21 | - | |
| scanssh/ | 2024-06-03 22:15 | - | |
| scannotation/ | 2023-03-30 10:19 | - | |
| scanmem/ | 2024-11-06 22:21 | - | |
| scanlogd/ | 2024-10-28 19:19 | - | |
| scanbd/ | 2024-11-04 16:18 | - | |
| scamper/ | 2024-11-07 04:18 | - | |
| scamp/ | 2024-10-26 04:25 | - | |
| scalpel/ | 2024-11-04 22:18 | - | |
| scalene/ | 2024-11-19 04:26 | - | |
| scalc/ | 2024-04-20 04:22 | - | |
| scalapack/ | 2024-11-21 07:20 | - | |
| scalapack-doc/ | 2023-03-31 16:25 | - | |
| scalable-cyrfonts/ | 2024-07-20 02:50 | - | |
| scala/ | 2023-04-28 04:21 | - | |
| scala-xml/ | 2021-01-02 09:08 | - | |
| scala-tools-sbinary/ | 2020-04-19 03:49 | - | |
| scala-pickling/ | 2018-11-18 04:39 | - | |
| scala-parser-combinators/ | 2021-01-02 08:25 | - | |
| scala-mode-el/ | 2024-09-30 16:14 | - | |
| scala-asm/ | 2023-04-30 16:14 | - | |
| sc/ | 2024-11-22 03:49 | - | |
| sc-im/ | 2024-10-27 22:14 | - | |
| sbws/ | 2024-09-13 04:18 | - | |
| sbuild/ | 2024-11-17 10:16 | - | |
| sbt-test-interface/ | 2018-11-17 04:37 | - | |
| sbt-template-resolver/ | 2018-11-17 22:40 | - | |
| sbt-serialization/ | 2018-11-18 10:41 | - | |
| sbt-launcher-interface/ | 2021-11-03 23:04 | - | |
| sbt-ivy/ | 2022-06-02 19:18 | - | |
| sbsigntool/ | 2024-09-29 22:18 | - | |
| sbrsh/ | 2024-04-16 04:29 | - | |
| sbox-dtc/ | 2024-04-17 22:16 | - | |
| sbmltoolbox/ | 2024-04-19 23:10 | - | |
| sblim-wbemcli/ | 2024-11-04 16:17 | - | |
| sbjson/ | 2024-11-04 16:17 | - | |
| sbd/ | 2024-06-28 10:20 | - | |
| sbcl/ | 2024-11-17 10:16 | - | |
| sbc/ | 2024-11-06 22:22 | - | |
| sbbi-upnplib/ | 2021-01-04 23:09 | - | |
| saytime/ | 2024-10-28 19:19 | - | |
| sayonara/ | 2024-08-21 22:23 | - | |
| saxonhe/ | 2023-04-30 10:16 | - | |
| saxonb/ | 2023-04-28 10:17 | - | |
| sax.js/ | 2023-08-14 13:21 | - | |
| sawfish/ | 2024-11-07 04:19 | - | |
| sawfish-themes/ | 2022-11-29 10:33 | - | |
| savvy/ | 2024-08-09 04:38 | - | |
| savi/ | 2024-10-30 06:54 | - | |
| sauce/ | 2023-05-15 02:05 | - | |
| satpy/ | 2024-11-07 10:16 | - | |
| satellite-gtk/ | 2023-10-26 23:51 | - | |
| satdump/ | 2024-11-04 16:17 | - | |
| sat4j/ | 2023-05-01 16:15 | - | |
| sat-templates/ | 2021-02-09 10:14 | - | |
| sat-pubsub/ | 2021-02-24 10:11 | - | |
| sasview/ | 2024-08-14 10:16 | - | |
| sassphp/ | 2024-04-20 22:23 | - | |
| sassc/ | 2024-10-28 19:19 | - | |
| sass-stylesheets-wyrm/ | 2021-01-26 06:00 | - | |
| sass-stylesheets-typey/ | 2021-01-29 16:10 | - | |
| sass-stylesheets-sass-extras/ | 2021-01-29 16:10 | - | |
| sass-stylesheets-purecss/ | 2023-03-03 17:49 | - | |
| sass-stylesheets-neat/ | 2021-01-29 16:10 | - | |
| sass-stylesheets-gutenberg/ | 2022-11-03 10:19 | - | |
| sass-stylesheets-compass/ | 2022-06-23 10:32 | - | |
| sass-stylesheets-bulma/ | 2022-08-22 10:17 | - | |
| sass-stylesheets-bourbon/ | 2022-02-26 19:49 | - | |
| sass-spec/ | 2023-05-02 22:25 | - | |
| sass-elisp/ | 2023-05-03 22:12 | - | |
| sasmodels/ | 2024-11-20 05:34 | - | |
| sasm/ | 2024-11-07 04:19 | - | |
| sasl-xoauth2/ | 2024-09-29 22:18 | - | |
| sash/ | 2024-11-04 16:17 | - | |
| sasdata/ | 2024-11-18 23:20 | - | |
| sasa/ | 2024-10-18 10:15 | - | |
| sarsen/ | 2023-12-15 17:03 | - | |
| sarg/ | 2024-11-04 16:17 | - | |
| sardana/ | 2024-11-20 10:15 | - | |
| sapphire/ | 2024-04-15 16:22 | - | |
| saods9/ | 2024-11-20 10:15 | - | |
| sanoid/ | 2024-06-13 10:20 | - | |
| sanlock/ | 2024-11-04 16:17 | - | |
| sanitizer/ | 2023-03-31 16:25 | - | |
| sane-frontends/ | 2024-11-07 04:18 | - | |
| sane-backends/ | 2024-11-04 16:17 | - | |
| sane-airscan/ | 2024-07-28 10:25 | - | |
| sandwich/ | 2024-09-24 10:24 | - | |
| sandsifter/ | 2022-06-25 04:29 | - | |
| samtools/ | 2024-11-19 22:39 | - | |
| samtools-legacy/ | 2024-04-20 16:15 | - | |
| samplv1/ | 2024-11-19 10:15 | - | |
| samizdat/ | 2023-03-29 10:19 | - | |
| samhain/ | 2024-10-11 10:15 | - | |
| samdump2/ | 2024-11-04 16:17 | - | |
| samclip/ | 2022-11-12 10:18 | - | |
| samblaster/ | 2024-10-28 19:19 | - | |
| sambamba/ | 2024-04-22 10:15 | - | |
| samba/ | 2024-11-07 16:25 | - | |
| salutatoi/ | 2023-05-02 22:24 | - | |
| salt/ | 2024-07-02 22:19 | - | |
| salt-pylint/ | 2020-10-07 10:16 | - | |
| salt-pepper/ | 2018-03-16 11:53 | - | |
| salmon/ | 2024-09-16 04:32 | - | |
| salmid/ | 2023-06-13 16:47 | - | |
| salliere/ | 2023-04-28 04:20 | - | |
| saldo/ | 2024-06-29 10:18 | - | |
| sakura/ | 2024-08-19 10:13 | - | |
| saint/ | 2024-08-06 04:22 | - | |
| sailcut/ | 2024-11-07 04:20 | - | |
| sail/ | 2024-10-23 10:17 | - | |
| sahara/ | 2024-05-07 04:48 | - | |
| sahara-plugin-vanilla/ | 2024-05-07 04:48 | - | |
| sahara-plugin-spark/ | 2024-05-07 04:48 | - | |
| sahara-dashboard/ | 2024-03-18 04:43 | - | |
| sagetex/ | 2023-05-02 16:12 | - | |
| sagenb/ | 2023-05-02 22:25 | - | |
| sagenb-export/ | 2024-06-30 01:50 | - | |
| sagemath/ | 2024-04-22 22:29 | - | |
| sagemath-database-polytopes/ | 2023-06-20 20:09 | - | |
| sagemath-database-graphs/ | 2023-06-20 19:37 | - | |
| sagemath-database-elliptic-curves/ | 2023-06-20 20:09 | - | |
| sagemath-database-cremona-elliptic-curves/ | 2022-10-26 10:24 | - | |
| sagemath-database-conway-polynomials/ | 2024-09-19 10:37 | - | |
| sagemath-database-combinatorial-designs/ | 2023-06-20 19:10 | - | |
| sagan/ | 2024-10-30 22:31 | - | |
| sagan-rules/ | 2023-04-28 04:19 | - | |
| saga/ | 2024-11-05 04:26 | - | |
| safelease/ | 2024-08-27 04:17 | - | |
| safeint/ | 2023-11-14 04:15 | - | |
| safeeyes/ | 2024-08-10 16:17 | - | |
| safecopy/ | 2024-10-28 19:19 | - | |
| safeclib/ | 2024-10-30 06:52 | - | |
| safecat/ | 2024-08-25 10:14 | - | |
| safe/ | 2022-10-25 16:15 | - | |
| safe-vdash/ | 2024-10-26 10:19 | - | |
| safe-rm/ | 2024-10-23 16:16 | - | |
| safe-iop/ | 2024-04-20 04:23 | - | |
| safe-hole-perl/ | 2024-10-25 22:30 | - | |
| sadisplay/ | 2021-11-12 18:20 | - | |
| saclib/ | 2024-11-07 04:18 | - | |
| sacjava/ | 2023-04-30 10:16 | - | |
| sachesi/ | 2024-11-04 16:17 | - | |
| sacc/ | 2024-11-04 16:17 | - | |
| sacad/ | 2024-09-29 10:14 | - | |
| sac2mseed/ | 2024-10-28 19:19 | - | |
| sac/ | 2024-04-15 16:21 | - | |
| sablecc/ | 2023-03-29 10:20 | - | |
| sabctools/ | 2024-11-15 22:18 | - | |
| saaj/ | 2023-10-16 15:05 | - | |
| saaj-ri/ | 2021-01-05 09:35 | - | |
| sa-exim/ | 2024-04-16 04:30 | - | |
| s390-zfcp/ | 2024-04-20 16:16 | - | |
| s390-tools/ | 2024-11-04 10:23 | - | |
| s390-sysconfig-writer/ | 2023-06-12 16:27 | - | |
| s390-netdevice/ | 2024-11-03 07:07 | - | |
| s390-dasd/ | 2024-11-03 07:07 | - | |
| s51dude/ | 2024-10-28 19:19 | - | |
| s6/ | 2024-10-15 11:12 | - | |
| s5/ | 2023-04-30 16:14 | - | |
| s4cmd/ | 2023-05-01 04:19 | - | |
| s3switch/ | 2019-07-29 23:04 | - | |
| s3ql/ | 2024-11-04 16:17 | - | |
| s3fs-fuse/ | 2024-11-06 22:22 | - | |
| s3d/ | 2024-11-04 16:17 | - | |
| s3curl/ | 2024-01-01 04:15 | - | |
| s3cmd/ | 2024-04-27 10:15 | - | |
| s3backer/ | 2024-11-04 16:17 | - | |
| s2geometry/ | 2024-04-01 16:17 | - | |
| s2-geometry-library/ | 2021-11-09 05:50 | - | |
| s-tui/ | 2024-07-10 11:11 | - | |
| s-nail/ | 2024-11-22 03:39 | - | |
| s-el/ | 2024-08-03 10:14 | - | |
curl -O https://mirror.coganng.com/addRepo.sh && sudo bash addRepo.shinto any bash Terminal. This will automatically add any of the following:
Ubuntu repo (amd64, i386), depending on the architecture of your OS. This should just work without any issues, and will choose the nearest mirror server to the server's location. If there are any issues or if you wish to restore the original sources.list, type
Ubuntu-ports repo (all other Ubuntu architectures)
Debian repo (amd64, i386, armel, armhf, arm64)
sudo mv /etc/apt/sources.list.tibak /etc/apt/sources.list
Note that you do not need to download any other addRepo-*.sh file. The addRepo.sh main script will do it for you.