![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| iraf-fitsutil/ | 2025-07-27 22:20 | - | |
| inotify-tools/ | 2025-07-27 22:20 | - | |
| icebreaker/ | 2025-07-27 22:19 | - | |
| intel-hdcp/ | 2025-07-27 22:19 | - | |
| iraf-sptable/ | 2025-07-27 22:18 | - | |
| iraf-rvsao/ | 2025-07-27 22:18 | - | |
| iraf-mscred/ | 2025-07-27 22:18 | - | |
| iraf/ | 2025-07-27 22:18 | - | |
| invesalius/ | 2025-07-27 22:18 | - | |
| ioquake3/ | 2025-07-27 22:18 | - | |
| imagination/ | 2025-07-27 22:17 | - | |
| iptables/ | 2025-07-27 22:17 | - | |
| ibus-pinyin/ | 2025-07-27 22:17 | - | |
| ibus-zhuyin/ | 2025-07-27 22:17 | - | |
| ibus-input-pad/ | 2025-07-27 22:16 | - | |
| ispell-uk/ | 2025-07-27 22:16 | - | |
| ircd-hybrid/ | 2025-07-27 22:16 | - | |
| installation-report/ | 2025-07-27 22:13 | - | |
| iso-scan/ | 2025-07-27 22:13 | - | |
| icecc/ | 2025-07-27 16:19 | - | |
| icinga2/ | 2025-07-27 16:19 | - | |
| ibus-kmfl/ | 2025-07-27 16:19 | - | |
| icom/ | 2025-07-27 16:18 | - | |
| imgvtopgm/ | 2025-07-27 16:18 | - | |
| imvirt/ | 2025-07-27 16:17 | - | |
| irtt/ | 2025-07-27 16:17 | - | |
| ipp-usb/ | 2025-07-27 16:17 | - | |
| imv/ | 2025-07-27 16:17 | - | |
| influxdb/ | 2025-07-27 16:15 | - | |
| iniparser/ | 2025-07-27 16:15 | - | |
| installation-guide/ | 2025-07-27 16:14 | - | |
| itcl3/ | 2025-07-27 16:14 | - | |
| ibam/ | 2025-07-27 16:14 | - | |
| init-system-helpers/ | 2025-07-27 16:13 | - | |
| iannix/ | 2025-07-27 16:13 | - | |
| ibus-anthy/ | 2025-07-27 10:22 | - | |
| ipmiutil/ | 2025-07-27 10:22 | - | |
| ibm-3270/ | 2025-07-27 10:22 | - | |
| imgui/ | 2025-07-27 10:21 | - | |
| ispell/ | 2025-07-27 10:21 | - | |
| ipwatchd-gnotify/ | 2025-07-27 10:21 | - | |
| insserv/ | 2025-07-27 10:21 | - | |
| id3lib3.8.3/ | 2025-07-27 10:21 | - | |
| ink/ | 2025-07-27 10:21 | - | |
| ipcalc-ng/ | 2025-07-27 10:21 | - | |
| ibus/ | 2025-07-27 10:20 | - | |
| idba/ | 2025-07-27 10:20 | - | |
| icecast2/ | 2025-07-27 10:20 | - | |
| inetutils/ | 2025-07-27 10:19 | - | |
| info-beamer/ | 2025-07-27 10:19 | - | |
| iputils/ | 2025-07-27 10:19 | - | |
| id3v2/ | 2025-07-27 10:19 | - | |
| itop/ | 2025-07-27 10:18 | - | |
| inputlirc/ | 2025-07-27 10:18 | - | |
| iat/ | 2025-07-27 10:18 | - | |
| iwyu/ | 2025-07-27 10:18 | - | |
| ipqalc/ | 2025-07-27 10:18 | - | |
| ivar/ | 2025-07-27 10:18 | - | |
| i2pd/ | 2025-07-27 10:18 | - | |
| ifd-gempc/ | 2025-07-27 04:16 | - | |
| ibus-kkc/ | 2025-07-27 04:16 | - | |
| input-pad/ | 2025-07-27 04:15 | - | |
| id3ren/ | 2025-07-27 04:15 | - | |
| isomaster/ | 2025-07-27 04:15 | - | |
| indent/ | 2025-07-27 04:14 | - | |
| ibus-sunpinyin/ | 2025-07-27 04:14 | - | |
| iio-sensor-proxy/ | 2025-07-26 22:50 | - | |
| ip4r/ | 2025-07-26 22:30 | - | |
| incron/ | 2025-07-26 22:30 | - | |
| iprutils/ | 2025-07-26 22:30 | - | |
| invada-studio-plugins-lv2/ | 2025-07-26 22:29 | - | |
| inspircd/ | 2025-07-26 22:27 | - | |
| identity4c/ | 2025-07-26 22:27 | - | |
| iwd/ | 2025-07-26 22:27 | - | |
| ipmitool/ | 2025-07-26 22:26 | - | |
| iml/ | 2025-07-26 16:14 | - | |
| iec16022/ | 2025-07-26 16:13 | - | |
| iagno/ | 2025-07-26 16:13 | - | |
| icoutils/ | 2025-07-26 16:12 | - | |
| irssi-plugin-robustirc/ | 2025-07-26 16:12 | - | |
| imapfilter/ | 2025-07-26 16:10 | - | |
| ifmail/ | 2025-07-26 16:10 | - | |
| istgt/ | 2025-07-26 16:09 | - | |
| i3status/ | 2025-07-26 16:09 | - | |
| inhomog/ | 2025-07-26 10:15 | - | |
| icmake/ | 2025-07-26 10:15 | - | |
| innoextract/ | 2025-07-26 10:15 | - | |
| iipimage/ | 2025-07-26 10:13 | - | |
| irsim/ | 2025-07-26 10:12 | - | |
| idzebra/ | 2025-07-26 10:12 | - | |
| isatapd/ | 2025-07-26 10:12 | - | |
| ignition-math/ | 2025-07-26 10:11 | - | |
| inxi/ | 2025-07-26 10:10 | - | |
| ismobilejs/ | 2025-07-26 10:10 | - | |
| iperf/ | 2025-07-26 10:10 | - | |
| irstlm/ | 2025-07-26 10:10 | - | |
| inkbird-ble/ | 2025-07-26 10:10 | - | |
| integrit/ | 2025-07-26 06:36 | - | |
| inform6-compiler/ | 2025-07-26 04:15 | - | |
| idesk/ | 2025-07-26 04:14 | - | |
| ifile/ | 2025-07-26 04:14 | - | |
| ikiwiki-hosting/ | 2025-07-26 04:14 | - | |
| i3lock/ | 2025-07-26 04:12 | - | |
| isc-dhcp/ | 2025-07-26 04:11 | - | |
| irssi/ | 2025-07-25 22:18 | - | |
| ibus-rime/ | 2025-07-25 22:18 | - | |
| iperf3/ | 2025-07-25 22:17 | - | |
| ippl/ | 2025-07-25 22:15 | - | |
| ipfm/ | 2025-07-25 22:13 | - | |
| imwheel/ | 2025-07-25 22:12 | - | |
| iproute2/ | 2025-07-25 16:14 | - | |
| iverilog/ | 2025-07-25 16:14 | - | |
| iotop-c/ | 2025-07-25 16:13 | - | |
| isync/ | 2025-07-25 16:13 | - | |
| ima-evm-utils/ | 2025-07-25 16:13 | - | |
| ibus-libpinyin/ | 2025-07-25 16:12 | - | |
| imagemagick/ | 2025-07-25 16:11 | - | |
| imlib2/ | 2025-07-25 16:10 | - | |
| ibus-libzhuyin/ | 2025-07-25 16:09 | - | |
| iptotal/ | 2025-07-25 10:16 | - | |
| inadyn/ | 2025-07-25 10:15 | - | |
| icu/ | 2025-07-25 10:15 | - | |
| ircii/ | 2025-07-25 10:13 | - | |
| inventor/ | 2025-07-25 10:12 | - | |
| inkscape/ | 2025-07-25 10:12 | - | |
| indicator-sensors/ | 2025-07-25 04:21 | - | |
| ibus-keyman/ | 2025-07-25 04:20 | - | |
| imx-code-signing-tool/ | 2025-07-25 04:20 | - | |
| icmpush/ | 2025-07-25 04:19 | - | |
| inn2/ | 2025-07-25 04:19 | - | |
| icewm/ | 2025-07-25 04:18 | - | |
| imview/ | 2025-07-25 04:17 | - | |
| i3-wm/ | 2025-07-25 04:17 | - | |
| imaptool/ | 2025-07-25 04:17 | - | |
| intel-gmmlib/ | 2025-07-25 04:17 | - | |
| intel-media-driver/ | 2025-07-25 04:17 | - | |
| indi/ | 2025-07-24 22:15 | - | |
| ike-scan/ | 2025-07-24 22:15 | - | |
| ipset/ | 2025-07-24 22:15 | - | |
| inn/ | 2025-07-24 22:15 | - | |
| igraph/ | 2025-07-24 22:15 | - | |
| iptux/ | 2025-07-24 22:14 | - | |
| irssi-plugin-xmpp/ | 2025-07-24 22:14 | - | |
| iva/ | 2025-07-24 22:14 | - | |
| ilmbase/ | 2025-07-24 22:14 | - | |
| ignition-msgs/ | 2025-07-24 22:14 | - | |
| icecc-monitor/ | 2025-07-24 22:13 | - | |
| install-mimic/ | 2025-07-24 22:13 | - | |
| intelrdfpmath/ | 2025-07-24 22:12 | - | |
| iitalian/ | 2025-07-24 22:12 | - | |
| ipe/ | 2025-07-24 22:12 | - | |
| iddawc/ | 2025-07-24 22:12 | - | |
| ibus-hangul/ | 2025-07-24 22:12 | - | |
| inputplug/ | 2025-07-24 22:12 | - | |
| itcl4/ | 2025-07-24 22:11 | - | |
| ignition-common/ | 2025-07-24 16:14 | - | |
| id3tool/ | 2025-07-24 16:14 | - | |
| isospec/ | 2025-07-24 16:14 | - | |
| ivtools/ | 2025-07-24 16:13 | - | |
| infnoise/ | 2025-07-24 16:12 | - | |
| icheck/ | 2025-07-24 16:12 | - | |
| ifrench-gut/ | 2025-07-24 16:12 | - | |
| ircd-irc2/ | 2025-07-24 16:12 | - | |
| ismrmrd/ | 2025-07-24 16:11 | - | |
| idevicerestore/ | 2025-07-24 16:11 | - | |
| icu-ext/ | 2025-07-24 10:16 | - | |
| instead/ | 2025-07-24 10:14 | - | |
| ignition-fuel-tools/ | 2025-07-24 10:14 | - | |
| isomd5sum/ | 2025-07-24 10:14 | - | |
| i2c-tools/ | 2025-07-24 10:14 | - | |
| id3/ | 2025-07-24 10:13 | - | |
| isl/ | 2025-07-24 10:12 | - | |
| ideep/ | 2025-07-24 10:12 | - | |
| ipe-tools/ | 2025-07-24 04:15 | - | |
| ifupdown/ | 2025-07-24 04:14 | - | |
| iw/ | 2025-07-24 04:14 | - | |
| imexam/ | 2025-07-24 04:14 | - | |
| ioping/ | 2025-07-24 04:13 | - | |
| ifstat/ | 2025-07-24 04:12 | - | |
| irqbalance/ | 2025-07-24 04:12 | - | |
| ifhp/ | 2025-07-23 22:18 | - | |
| ipv6toolkit/ | 2025-07-23 22:18 | - | |
| ipip/ | 2025-07-23 22:18 | - | |
| igor/ | 2025-07-23 22:18 | - | |
| inchi/ | 2025-07-23 22:18 | - | |
| iftop/ | 2025-07-23 22:18 | - | |
| ii-esu/ | 2025-07-23 22:18 | - | |
| ignition-transport/ | 2025-07-23 22:18 | - | |
| iotop/ | 2025-07-23 22:18 | - | |
| icu-le-hb/ | 2025-07-23 22:18 | - | |
| imx-usb-loader/ | 2025-07-23 22:18 | - | |
| ibus-libthai/ | 2025-07-23 22:17 | - | |
| iem-plugin-suite/ | 2025-07-23 22:17 | - | |
| irrlicht/ | 2025-07-23 16:41 | - | |
| idlestat/ | 2025-07-23 16:40 | - | |
| ideviceinstaller/ | 2025-07-23 10:19 | - | |
| irony-mode/ | 2025-07-23 10:18 | - | |
| ispell-fo/ | 2025-07-23 10:18 | - | |
| imgsizer/ | 2025-07-23 10:18 | - | |
| icingadb-web/ | 2025-07-23 10:14 | - | |
| igtf-policy-bundle/ | 2025-07-23 04:16 | - | |
| icingaweb2-module-statusmap/ | 2025-07-22 23:04 | - | |
| icingaweb2-module-nagvis/ | 2025-07-22 23:04 | - | |
| icingaweb2-module-map/ | 2025-07-22 23:04 | - | |
| icingaweb2-module-generictts/ | 2025-07-22 23:04 | - | |
| icingaweb2-module-reporting/ | 2025-07-22 22:48 | - | |
| icingaweb2-module-graphite/ | 2025-07-22 22:48 | - | |
| icingaweb2-module-fileshipper/ | 2025-07-22 22:37 | - | |
| icingaweb2-module-eventdb/ | 2025-07-22 20:18 | - | |
| icingaweb2-module-audit/ | 2025-07-22 20:04 | - | |
| istack-commons/ | 2025-07-22 10:15 | - | |
| ibus-table/ | 2025-07-22 04:15 | - | |
| isort/ | 2025-07-22 04:15 | - | |
| intel-cmt-cat/ | 2025-07-22 04:14 | - | |
| imenu-list/ | 2025-07-22 04:14 | - | |
| ii/ | 2025-07-22 04:14 | - | |
| imanx/ | 2025-07-22 04:14 | - | |
| intel-gpu-tools/ | 2025-07-22 04:13 | - | |
| ironic-inspector/ | 2025-07-22 04:13 | - | |
| ironic/ | 2025-07-22 04:13 | - | |
| imagetooth/ | 2025-07-22 04:13 | - | |
| ispell-tl/ | 2025-07-22 04:13 | - | |
| ipdb/ | 2025-07-22 04:12 | - | |
| iirish/ | 2025-07-22 04:12 | - | |
| installation-locale/ | 2025-07-21 22:16 | - | |
| ibus-array/ | 2025-07-21 22:16 | - | |
| imagej/ | 2025-07-21 22:16 | - | |
| impressive/ | 2025-07-21 22:16 | - | |
| ivy/ | 2025-07-21 22:16 | - | |
| impacket/ | 2025-07-21 22:15 | - | |
| indelible/ | 2025-07-21 22:15 | - | |
| iselect/ | 2025-07-21 22:15 | - | |
| iso-codes/ | 2025-07-21 22:15 | - | |
| itk4/ | 2025-07-21 22:15 | - | |
| influxdb-python/ | 2025-07-21 22:14 | - | |
| iptraf-ng/ | 2025-07-21 22:14 | - | |
| insighttoolkit4/ | 2025-07-21 22:14 | - | |
| idjc/ | 2025-07-21 22:13 | - | |
| insubstantial/ | 2025-07-21 16:16 | - | |
| info2man/ | 2025-07-21 16:16 | - | |
| ipig/ | 2025-07-21 16:16 | - | |
| imediff/ | 2025-07-21 16:16 | - | |
| ispell-gl/ | 2025-07-21 16:15 | - | |
| ieee-data/ | 2025-07-21 16:15 | - | |
| ipvsadm/ | 2025-07-21 16:14 | - | |
| ilisp/ | 2025-07-21 16:14 | - | |
| ibus-table-others/ | 2025-07-21 16:14 | - | |
| iodine/ | 2025-07-21 16:13 | - | |
| ibus-table-extraphrase/ | 2025-07-21 10:13 | - | |
| ipxe/ | 2025-07-21 10:13 | - | |
| indexed-gzip/ | 2025-07-21 10:12 | - | |
| img2pdf/ | 2025-07-21 10:12 | - | |
| igaelic/ | 2025-07-21 10:12 | - | |
| intellij-annotations/ | 2025-07-21 10:12 | - | |
| itksnap/ | 2025-07-21 10:12 | - | |
| ifetch-tools/ | 2025-07-21 10:12 | - | |
| ioport/ | 2025-07-21 10:12 | - | |
| iaxmodem/ | 2025-07-21 10:12 | - | |
| iapws/ | 2025-07-21 10:12 | - | |
| infinipath-psm/ | 2025-07-21 10:11 | - | |
| ixo-usb-jtag/ | 2025-07-21 10:10 | - | |
| intelhex/ | 2025-07-21 10:10 | - | |
| ibus-m17n/ | 2025-07-21 04:15 | - | |
| its/ | 2025-07-21 04:15 | - | |
| intltool/ | 2025-07-21 04:15 | - | |
| ispell-lt/ | 2025-07-21 04:14 | - | |
| ibus-braille/ | 2025-07-21 04:13 | - | |
| irclog2html/ | 2025-07-21 04:13 | - | |
| isenkram/ | 2025-07-21 04:12 | - | |
| icingaweb2/ | 2025-07-21 04:12 | - | |
| iqtree/ | 2025-07-21 04:12 | - | |
| intel-ipsec-mb/ | 2025-07-21 04:12 | - | |
| im/ | 2025-07-20 22:16 | - | |
| ibus-cangjie/ | 2025-07-20 22:16 | - | |
| i7z/ | 2025-07-20 22:16 | - | |
| ivyplusplus/ | 2025-07-20 22:15 | - | |
| intercal/ | 2025-07-20 22:15 | - | |
| ibutils/ | 2025-07-20 22:15 | - | |
| i18nspector/ | 2025-07-20 22:15 | - | |
| ipsvd/ | 2025-07-20 22:15 | - | |
| isa-support/ | 2025-07-20 22:14 | - | |
| icu4j/ | 2025-07-20 22:12 | - | |
| iptables-netflow/ | 2025-07-20 22:12 | - | |
| ifupdown-extra/ | 2025-07-20 16:15 | - | |
| icu4j-4.4/ | 2025-07-20 16:15 | - | |
| interimap/ | 2025-07-20 16:15 | - | |
| indigo/ | 2025-07-20 16:15 | - | |
| ikiwiki/ | 2025-07-20 16:14 | - | |
| ipmctl/ | 2025-07-20 16:13 | - | |
| ifupdown2/ | 2025-07-20 16:13 | - | |
| ido-vertical-mode/ | 2025-07-20 16:12 | - | |
| iedit/ | 2025-07-20 16:12 | - | |
| ibuffer-vc/ | 2025-07-20 16:12 | - | |
| islamic-menus/ | 2025-07-20 16:12 | - | |
| ironic-ui/ | 2025-07-20 16:12 | - | |
| itypes/ | 2025-07-20 16:12 | - | |
| ipolish/ | 2025-07-20 10:16 | - | |
| irker/ | 2025-07-20 10:16 | - | |
| intel2gas/ | 2025-07-20 10:14 | - | |
| icinga-php-thirdparty/ | 2025-07-20 10:14 | - | |
| installation-birthday/ | 2025-07-20 10:14 | - | |
| inspectrum/ | 2025-07-20 10:13 | - | |
| isoquery/ | 2025-07-20 10:13 | - | |
| itango/ | 2025-07-20 10:13 | - | |
| itk3/ | 2025-07-20 10:13 | - | |
| inflection/ | 2025-07-20 10:13 | - | |
| ispell.pt/ | 2025-07-20 10:13 | - | |
| iroffer/ | 2025-07-20 10:13 | - | |
| icecream-sundae/ | 2025-07-20 04:21 | - | |
| imdbpy/ | 2025-07-20 04:21 | - | |
| igmpproxy/ | 2025-07-20 04:21 | - | |
| imgp/ | 2025-07-20 04:21 | - | |
| ifplugd/ | 2025-07-20 04:21 | - | |
| infernal/ | 2025-07-20 04:21 | - | |
| icinga-php-library/ | 2025-07-20 04:20 | - | |
| ipython-genutils/ | 2025-07-20 04:19 | - | |
| inetsim/ | 2025-07-20 04:18 | - | |
| initsplit-el/ | 2025-07-20 04:18 | - | |
| ibus-unikey/ | 2025-07-19 22:25 | - | |
| isbnlib/ | 2025-07-19 22:22 | - | |
| i8kutils/ | 2025-07-19 16:15 | - | |
| inform6-library/ | 2025-07-19 16:15 | - | |
| incremental/ | 2025-07-19 16:14 | - | |
| ifscheme/ | 2025-07-19 10:15 | - | |
| itstool/ | 2025-07-19 10:15 | - | |
| itamae/ | 2025-07-19 10:14 | - | |
| ido-ubiquitous/ | 2025-07-19 10:13 | - | |
| ipgrab/ | 2025-07-19 10:13 | - | |
| ipband/ | 2025-07-19 04:17 | - | |
| intel-vaapi-driver/ | 2025-07-19 04:17 | - | |
| ices2/ | 2025-07-19 04:17 | - | |
| intel-processor-trace/ | 2025-07-19 04:17 | - | |
| idlastro/ | 2025-07-19 04:14 | - | |
| i3pystatus/ | 2025-07-18 22:17 | - | |
| ibus-client-clutter/ | 2025-07-18 22:16 | - | |
| ir.lv2/ | 2025-07-18 22:15 | - | |
| inifile/ | 2025-07-18 22:15 | - | |
| its-playback-time/ | 2025-07-18 16:15 | - | |
| ipv6pref/ | 2025-07-18 16:14 | - | |
| iwatch/ | 2025-07-18 16:14 | - | |
| icon-naming-utils/ | 2025-07-18 16:13 | - | |
| ispell-et/ | 2025-07-18 10:14 | - | |
| ivykis/ | 2025-07-18 10:14 | - | |
| ibsim/ | 2025-07-18 10:14 | - | |
| isodate/ | 2025-07-18 10:13 | - | |
| igal2/ | 2025-07-18 10:12 | - | |
| iptables-persistent/ | 2025-07-18 04:14 | - | |
| ipyparallel/ | 2025-07-18 04:14 | - | |
| iptables-converter/ | 2025-07-18 04:12 | - | |
| impass/ | 2025-07-17 22:15 | - | |
| ispell-czech/ | 2025-07-17 22:15 | - | |
| icedtea-web/ | 2025-07-17 16:15 | - | |
| ipy/ | 2025-07-17 16:14 | - | |
| ircd-ircu/ | 2025-07-17 16:13 | - | |
| ibuffer-projectile/ | 2025-07-17 16:12 | - | |
| inotify-hookable/ | 2025-07-17 10:20 | - | |
| ino-headers/ | 2025-07-17 10:20 | - | |
| ignition-cmake/ | 2025-07-17 10:19 | - | |
| iwidgets4/ | 2025-07-17 10:18 | - | |
| ipv6calc/ | 2025-07-17 10:18 | - | |
| igerman98/ | 2025-07-17 10:17 | - | |
| instaparse-clojure/ | 2025-07-17 04:16 | - | |
| invaders/ | 2025-07-17 04:16 | - | |
| iso-flags-svg/ | 2025-07-17 04:16 | - | |
| icdiff/ | 2025-07-17 04:16 | - | |
| inform-mode/ | 2025-07-17 04:16 | - | |
| ifrench/ | 2025-07-17 04:16 | - | |
| intlfonts/ | 2025-07-17 04:16 | - | |
| ini4j/ | 2025-07-17 04:16 | - | |
| initz/ | 2025-07-17 04:16 | - | |
| imediff2/ | 2025-07-17 04:15 | - | |
| imaprowl/ | 2025-07-17 04:15 | - | |
| ipython/ | 2025-07-17 04:15 | - | |
| isoqlog/ | 2025-07-17 04:15 | - | |
| ijs/ | 2025-07-17 04:14 | - | |
| ifupdown-multi/ | 2025-07-17 04:14 | - | |
| ip2host/ | 2025-07-17 04:14 | - | |
| idle3-tools/ | 2025-07-17 04:14 | - | |
| impress.js/ | 2025-07-17 04:14 | - | |
| idl-font-lock-el/ | 2025-07-17 04:14 | - | |
| ionit/ | 2025-07-17 04:14 | - | |
| ipadic/ | 2025-07-16 22:18 | - | |
| initramfs-tools/ | 2025-07-16 22:18 | - | |
| icc-profiles-free/ | 2025-07-16 22:17 | - | |
| icecream/ | 2025-07-16 22:17 | - | |
| ipywidgets/ | 2025-07-16 22:17 | - | |
| ipykernel/ | 2025-07-16 22:17 | - | |
| ident2/ | 2025-07-16 22:17 | - | |
| i3lock-fancy/ | 2025-07-16 22:16 | - | |
| irssi-scripts/ | 2025-07-16 22:16 | - | |
| ipcalc/ | 2025-07-16 22:16 | - | |
| im-config/ | 2025-07-16 22:16 | - | |
| ifenslave/ | 2025-07-16 22:16 | - | |
| impose+/ | 2025-07-16 22:16 | - | |
| ivy-debian-helper/ | 2025-07-16 22:16 | - | |
| iisemulator/ | 2025-07-16 22:16 | - | |
| icon-slicer/ | 2025-07-16 22:15 | - | |
| ink-generator/ | 2025-07-16 22:15 | - | |
| info2www/ | 2025-07-16 22:15 | - | |
| i2util/ | 2025-07-16 16:14 | - | |
| inoticoming/ | 2025-07-16 16:13 | - | |
| icmpinfo/ | 2025-07-16 16:11 | - | |
| in-toto-golang/ | 2025-07-06 10:16 | - | |
| incus/ | 2025-07-06 10:16 | - | |
| ignition/ | 2025-07-06 10:16 | - | |
| icingadb/ | 2025-07-06 10:16 | - | |
| invidtui/ | 2025-07-06 10:14 | - | |
| icoextract/ | 2025-06-30 22:15 | - | |
| interegular/ | 2025-06-25 17:00 | - | |
| isc-kea/ | 2025-06-09 10:10 | - | |
| iprange/ | 2025-06-06 13:19 | - | |
| insighttoolkit5/ | 2025-06-01 06:47 | - | |
| igloohome-api/ | 2025-05-30 19:50 | - | |
| identify/ | 2025-05-27 22:31 | - | |
| itinerary/ | 2025-05-17 10:13 | - | |
| isoimagewriter/ | 2025-05-17 10:13 | - | |
| ibus-typing-booster/ | 2025-05-17 10:13 | - | |
| intellij-community-idea/ | 2025-05-16 10:13 | - | |
| indi-eqmod/ | 2025-05-15 22:21 | - | |
| inotify-info/ | 2025-05-15 10:17 | - | |
| iredis/ | 2025-05-15 10:17 | - | |
| image-garden/ | 2025-05-08 20:34 | - | |
| id-utils/ | 2025-05-06 10:19 | - | |
| importlab/ | 2025-05-02 11:16 | - | |
| ikvswitch/ | 2025-04-24 10:22 | - | |
| idseq-bench/ | 2025-04-17 13:18 | - | |
| ifeffit/ | 2025-04-15 10:22 | - | |
| ikarus/ | 2025-04-15 05:37 | - | |
| intel-lpmd/ | 2025-04-15 04:27 | - | |
| ibus-skk/ | 2025-04-14 04:19 | - | |
| ironic-python-agent/ | 2025-04-11 22:24 | - | |
| iitii/ | 2025-04-11 19:05 | - | |
| icingaweb2-module-pnp/ | 2025-04-11 10:19 | - | |
| icingaweb2-module-pdfexport/ | 2025-04-11 10:18 | - | |
| itsol/ | 2025-04-10 22:21 | - | |
| interception-tools/ | 2025-04-10 22:21 | - | |
| icingaweb2-module-boxydash/ | 2025-04-10 10:17 | - | |
| icingaweb2-module-director/ | 2025-04-10 10:17 | - | |
| icingaweb2-module-cube/ | 2025-04-10 10:16 | - | |
| icingaweb2-module-businessprocess/ | 2025-04-10 10:16 | - | |
| icingaweb2-module-toplevelview/ | 2025-04-10 10:14 | - | |
| icingaweb2-module-x509/ | 2025-04-10 10:14 | - | |
| imap-tools/ | 2025-04-08 05:20 | - | |
| incidenceeditor/ | 2025-04-07 10:29 | - | |
| ironic-tempest-plugin/ | 2025-04-06 10:21 | - | |
| iotas/ | 2025-04-06 10:21 | - | |
| iaqualink/ | 2025-04-06 04:25 | - | |
| ispc/ | 2025-04-03 10:16 | - | |
| israel-rail-api/ | 2025-04-02 22:14 | - | |
| iottycloud/ | 2025-04-02 22:14 | - | |
| ifupdown-ng/ | 2025-04-02 10:30 | - | |
| icingaweb2-module-idoreports/ | 2025-04-01 10:14 | - | |
| icon/ | 2025-03-30 10:21 | - | |
| injeqt/ | 2025-03-26 22:16 | - | |
| imapcopy/ | 2025-03-26 22:15 | - | |
| inotifyrecursive/ | 2025-03-26 10:16 | - | |
| iminuit/ | 2025-03-26 10:16 | - | |
| icingaweb2-module-incubator/ | 2025-03-25 10:17 | - | |
| intel-vc-intrinsics/ | 2025-03-25 10:16 | - | |
| intel-graphics-compiler2/ | 2025-03-24 22:39 | - | |
| intel-compute-runtime/ | 2025-03-24 22:38 | - | |
| inkscape-textext/ | 2025-03-22 10:22 | - | |
| intel-compute-runtime-legacy/ | 2025-03-19 04:20 | - | |
| isochron/ | 2025-03-16 04:20 | - | |
| imsprog/ | 2025-03-14 10:46 | - | |
| ibus-chewing/ | 2025-03-06 10:15 | - | |
| intrusive-shared-ptr/ | 2025-02-27 10:23 | - | |
| iaito/ | 2025-02-25 10:22 | - | |
| input-remapper/ | 2025-02-25 10:22 | - | |
| iotawattpy/ | 2025-02-23 10:20 | - | |
| ipp-crypto/ | 2025-02-15 10:21 | - | |
| intel-graphics-compiler/ | 2025-02-14 04:25 | - | |
| instaloader/ | 2025-02-07 10:15 | - | |
| ilorest/ | 2025-02-05 10:18 | - | |
| imath/ | 2025-01-29 16:23 | - | |
| importmagic/ | 2025-01-16 10:18 | - | |
| importlib-resources/ | 2025-01-13 10:22 | - | |
| imageindex/ | 2025-01-12 10:21 | - | |
| inkscape-open-symbols/ | 2025-01-09 10:21 | - | |
| i3blocks/ | 2025-01-07 10:17 | - | |
| invokebinder/ | 2025-01-01 22:20 | - | |
| isbg/ | 2024-12-31 10:22 | - | |
| icmptx/ | 2024-12-24 10:18 | - | |
| iptstate/ | 2024-12-18 22:22 | - | |
| igdiscover/ | 2024-12-15 04:19 | - | |
| igor2/ | 2024-12-13 10:17 | - | |
| in-place/ | 2024-12-13 10:17 | - | |
| ignition-plugin/ | 2024-12-10 10:14 | - | |
| ignition-tools/ | 2024-12-10 10:14 | - | |
| ignition-utils/ | 2024-12-10 10:14 | - | |
| ignition-physics/ | 2024-12-10 04:23 | - | |
| iconnect-tools/ | 2024-11-23 00:49 | - | |
| indi-gphoto/ | 2024-11-07 04:18 | - | |
| indi-gige/ | 2024-11-05 04:26 | - | |
| indi-apogee/ | 2024-11-03 22:22 | - | |
| indi-limesdr/ | 2024-11-03 22:22 | - | |
| indi-sx/ | 2024-11-03 10:22 | - | |
| indi-orion-ssg3/ | 2024-11-03 10:22 | - | |
| indi-nightscape/ | 2024-11-03 10:22 | - | |
| indi-ffmv/ | 2024-11-03 10:22 | - | |
| indi-armadillo-platypus/ | 2024-11-03 10:22 | - | |
| iwgtk/ | 2024-11-02 16:21 | - | |
| innduct/ | 2024-11-02 16:20 | - | |
| indi-dsi/ | 2024-11-02 16:20 | - | |
| ipheth/ | 2024-11-02 16:20 | - | |
| ifuse/ | 2024-11-02 16:20 | - | |
| indi-weewx-json/ | 2024-11-02 16:19 | - | |
| indi-starbook/ | 2024-11-02 16:19 | - | |
| indi-gpsd/ | 2024-11-02 16:19 | - | |
| indi-spectracyber/ | 2024-11-02 16:19 | - | |
| indi-bresserexos2/ | 2024-11-02 16:19 | - | |
| ical2html/ | 2024-11-02 16:19 | - | |
| indi-starbook-ten/ | 2024-11-02 16:19 | - | |
| indi-aok/ | 2024-11-02 16:19 | - | |
| ippsample/ | 2024-11-02 10:34 | - | |
| ifcplusplus/ | 2024-11-01 04:58 | - | |
| invada-studio-plugins/ | 2024-10-30 06:52 | - | |
| itools/ | 2024-10-30 06:52 | - | |
| indi-talon6/ | 2024-10-28 15:52 | - | |
| indi-shelyak/ | 2024-10-28 15:52 | - | |
| indi-rtklib/ | 2024-10-28 15:52 | - | |
| indi-nexdome/ | 2024-10-28 15:52 | - | |
| indi-mgen/ | 2024-10-28 15:52 | - | |
| indi-maxdomeii/ | 2024-10-28 15:52 | - | |
| indi-gpsnmea/ | 2024-10-28 15:52 | - | |
| indi-fli/ | 2024-10-28 15:52 | - | |
| indi-dreamfocuser/ | 2024-10-28 15:52 | - | |
| indi-beefocus/ | 2024-10-28 15:52 | - | |
| indi-avalon/ | 2024-10-28 15:52 | - | |
| indi-astromechfoc/ | 2024-10-28 15:51 | - | |
| indi-astrolink4/ | 2024-10-28 15:51 | - | |
| illustrate/ | 2024-10-28 15:51 | - | |
| ifmetric/ | 2024-10-28 15:51 | - | |
| indi-aagcloudwatcher-ng/ | 2024-10-28 11:06 | - | |
| imbalanced-learn/ | 2024-10-22 10:14 | - | |
| igv/ | 2024-10-22 10:14 | - | |
| itkadaptivedenoising/ | 2024-10-18 10:15 | - | |
| ipwatchd/ | 2024-10-01 10:15 | - | |
| input-utils/ | 2024-09-19 22:21 | - | |
| isrcsubmit/ | 2024-09-14 10:16 | - | |
| indie-wiki-buddy/ | 2024-09-12 10:14 | - | |
| ironseed/ | 2024-09-10 10:19 | - | |
| itkgenericlabelinterpolator/ | 2024-09-03 04:18 | - | |
| iir1/ | 2024-08-25 10:14 | - | |
| indi-webcam/ | 2024-08-05 22:23 | - | |
| inheritenv/ | 2024-07-30 10:19 | - | |
| irssi-rocketchat/ | 2024-07-28 22:16 | - | |
| image-analyzer/ | 2024-06-09 10:18 | - | |
| in-n-out/ | 2024-05-15 04:17 | - | |
| iceoryx/ | 2024-05-06 04:21 | - | |
| iraf-st4gem/ | 2024-04-29 10:16 | - | |
| insilicoseq/ | 2024-04-29 10:16 | - | |
| ircmarkers/ | 2024-04-20 10:17 | - | |
| ips/ | 2024-04-20 10:17 | - | |
| ibus-table-chinese/ | 2024-04-20 00:20 | - | |
| interface99/ | 2024-04-19 22:19 | - | |
| ipkungfu/ | 2024-04-18 10:31 | - | |
| ibus-avro/ | 2024-04-13 10:14 | - | |
| iraf-xdimsum/ | 2024-02-25 16:19 | - | |
| immer/ | 2024-02-12 22:23 | - | |
| intake/ | 2024-01-10 16:14 | - | |
| in-toto/ | 2023-11-15 19:03 | - | |
| icingaweb2-module-ipl/ | 2023-06-21 10:28 | - | |
| infomas-asl/ | 2023-06-13 03:28 | - | |
| iog/ | 2023-05-08 16:13 | - | |
| image-factory/ | 2023-05-03 10:15 | - | |
| impressive-display/ | 2023-05-02 10:14 | - | |
| io-stringy/ | 2023-04-30 22:14 | - | |
| isorelax/ | 2023-04-30 16:15 | - | |
| ice-builder-gradle/ | 2023-04-30 16:13 | - | |
| idm-console-framework/ | 2023-04-30 04:24 | - | |
| intltool-debian/ | 2023-04-29 10:18 | - | |
| i810switch/ | 2023-03-28 16:19 | - | |
| iucode-tool/ | 2023-02-21 16:12 | - | |
| intervalstorej/ | 2022-11-10 04:19 | - | |
| intel-mediasdk/ | 2022-10-26 10:24 | - | |
| intel-opencl-clang/ | 2022-10-12 10:21 | - | |
| icingaweb2-module-metapackages/ | 2022-07-29 22:17 | - | |
| icingaweb2-module-reactbundle/ | 2022-01-06 20:33 | - | |
| icb-utils/ | 2021-11-06 00:18 | - | |
| inkscape-survex-export/ | 2021-01-03 10:11 | - | |
| intellij-java-compatibility/ | 2020-11-02 04:28 | - | |
| inkscape-speleo/ | 2020-01-08 16:28 | - | |
| imip-agent/ | 2019-01-10 04:43 | - | |
curl -O https://mirror.coganng.com/addRepo.sh && sudo bash addRepo.shinto any bash Terminal. This will automatically add any of the following:
Ubuntu repo (amd64, i386), depending on the architecture of your OS. This should just work without any issues, and will choose the nearest mirror server to the server's location. If there are any issues or if you wish to restore the original sources.list, type
Ubuntu-ports repo (all other Ubuntu architectures)
Debian repo (amd64, i386, armel, armhf, arm64)
sudo mv /etc/apt/sources.list.tibak /etc/apt/sources.list
Note that you do not need to download any other addRepo-*.sh file. The addRepo.sh main script will do it for you.